for windows video

.env.local

@@ -0,0 +1,49 @@
+APP_NAME=Laravel
+APP_ENV=local
+APP_KEY=base64:huv04dD9NHrCHQ4HqLhp9GqOgBm6Kgnhn88VNh0OzAk=
+APP_DEBUG=true
+APP_URL=http://localhost
+
+LOG_CHANNEL=stack
+
+DB_CONNECTION=mysql
+DB_HOST=127.0.0.1
+DB_PORT=3306
+DB_DATABASE=ins
+DB_USERNAME=root
+DB_PASSWORD=
+
+
+BROADCAST_DRIVER=log
+CACHE_DRIVER=file
+QUEUE_CONNECTION=sync
+SESSION_DRIVER=file
+SESSION_LIFETIME=120
+
+REDIS_HOST=127.0.0.1
+REDIS_PASSWORD=null
+REDIS_PORT=6379
+
+MAIL_DRIVER=smtp
+MAIL_HOST=smtp.mailtrap.io
+MAIL_PORT=2525
+MAIL_USERNAME=null
+MAIL_PASSWORD=null
+MAIL_ENCRYPTION=null
+
+PUSHER_APP_ID=
+PUSHER_APP_KEY=
+PUSHER_APP_SECRET=
+PUSHER_APP_CLUSTER=mt1
+
+MIX_PUSHER_APP_KEY="${PUSHER_APP_KEY}"
+MIX_PUSHER_APP_CLUSTER="${PUSHER_APP_CLUSTER}"
+
+OAUTH_APP_ID=89b50ce9-fcd4-4d6b-a830-bbfe0fa5703b
+OAUTH_APP_PASSWORD=gmwsDOF38_+ycvIDAH885[)
+OAUTH_REDIRECT_URI=http://localhost:8000/callback
+#OAUTH_SCOPES='openid profile offline_access user.read calendars.read Files.Read.All, Files.ReadWrite.All, Sites.Read.All, Sites.ReadWrite.All'
+OAUTH_SCOPES='openid profile offline_access user.read calendars.read'
+OAUTH_AUTHORITY=https://login.microsoftonline.com/common
+OAUTH_AUTHORIZE_ENDPOINT=/oauth2/v2.0/authorize
+OAUTH_TOKEN_ENDPOINT=/oauth2/v2.0/token

.gitignore

@@ -1,12 +1,32 @@
-/node_modules
-/public/hot
-/public/storage
-/storage/*.key
-/vendor
-.env
-.phpunit.result.cache
-Homestead.json
-Homestead.yaml
+/vendor/
+node_modules/
 npm-debug.log
 yarn-error.log
-/.idea
+
+# Laravel 4 specific
+bootstrap/compiled.php
+app/storage/
+
+# Laravel 5 & Lumen specific
+public/storage
+public/hot
+
+# Laravel 5 & Lumen specific with changed public path
+public_html/storage
+public_html/hot
+
+storage/*.key
+storage/.DS_Store
+.env
+Homestead.yaml
+Homestead.json
+/.vagrant
+.phpunit.result.cache
+.idea/*
+.DS_Store
+.env.local
+.env.prod
+fail.log
+my.log
+cookie.txt
+*.jpg

.idea/dictionaries/shixuesen.xml

@@ -1,7 +0,0 @@
-<component name="ProjectDictionaryState">
-  <dictionary name="shixuesen">
-    <words>
-      <w>instagram</w>
-    </words>
-  </dictionary>
-</component>

.idea/encodings.xml

@@ -1,4 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<project version="4">
-  <component name="Encoding" addBOMForNewFiles="with NO BOM" />
-</project>

.idea/graph-tutorial.iml

@@ -1,127 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<module type="WEB_MODULE" version="4">
-  <component name="NewModuleRootManager">
-    <content url="file://$MODULE_DIR$">
-      <sourceFolder url="file://$MODULE_DIR$/tests" isTestSource="true" packagePrefix="Tests\" />
-      <sourceFolder url="file://$MODULE_DIR$/app" isTestSource="false" packagePrefix="App\" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/barryvdh/laravel-ide-helper" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/barryvdh/reflection-docblock" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/beyondcode/laravel-dump-server" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/binsoul/net-mqtt" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/binsoul/net-mqtt-client-react" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/clue/http-proxy-react" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/clue/socks-react" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/composer" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/corneltek/getoptionkit" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/dnoegel/php-xdg-base-dir" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/doctrine/cache" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/doctrine/dbal" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/doctrine/event-manager" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/doctrine/inflector" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/doctrine/instantiator" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/doctrine/lexer" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/dragonmantank/cron-expression" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/egulias/email-validator" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/erusev/parsedown" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/evenement/evenement" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/fideloper/proxy" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/filp/whoops" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/fzaninotto/faker" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/guzzlehttp/guzzle" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/guzzlehttp/promises" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/guzzlehttp/psr7" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/hamcrest/hamcrest-php" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/jakub-onderka/php-console-color" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/jakub-onderka/php-console-highlighter" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/justinrainbow/json-schema" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/laravel/framework" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/laravel/nexmo-notification-channel" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/laravel/slack-notification-channel" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/laravel/tinker" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/lazyjsonmapper/lazyjsonmapper" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/lcobucci/jwt" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/league/flysystem" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/league/oauth2-client" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/mgp25/instagram-php" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/microsoft/microsoft-graph" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/mockery/mockery" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/monolog/monolog" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/myclabs/deep-copy" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/nesbot/carbon" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/nexmo/client" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/nikic/php-parser" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/nunomaduro/collision" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/opis/closure" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/paragonie/random_compat" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phar-io/manifest" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phar-io/version" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/php-http/guzzle6-adapter" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/php-http/httplug" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/php-http/promise" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpdocumentor/reflection-common" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpdocumentor/reflection-docblock" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpdocumentor/type-resolver" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpspec/prophecy" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpunit/php-code-coverage" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpunit/php-file-iterator" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpunit/php-text-template" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpunit/php-timer" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpunit/php-token-stream" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/phpunit/phpunit" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/psr/container" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/psr/http-message" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/psr/log" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/psr/simple-cache" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/psy/psysh" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/ralouphie/getallheaders" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/ramsey/uuid" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/react/cache" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/react/dns" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/react/event-loop" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/react/promise" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/react/promise-timer" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/react/socket" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/react/stream" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/ringcentral/psr7" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/code-unit-reverse-lookup" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/comparator" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/diff" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/environment" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/exporter" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/global-state" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/object-enumerator" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/object-reflector" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/recursion-context" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/resource-operations" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/sebastian/version" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/seld/jsonlint" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/seld/phar-utils" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/swiftmailer/swiftmailer" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/console" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/contracts" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/css-selector" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/debug" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/event-dispatcher" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/filesystem" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/finder" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/http-foundation" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/http-kernel" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/polyfill-ctype" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/polyfill-mbstring" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/polyfill-php72" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/process" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/routing" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/translation" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/symfony/var-dumper" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/theseer/tokenizer" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/tijsverkoyen/css-to-inline-styles" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/valga/fbns-react" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/vlucas/phpdotenv" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/webmozart/assert" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/winbox/args" />
-      <excludeFolder url="file://$MODULE_DIR$/vendor/zendframework/zend-diactoros" />
-    </content>
-    <orderEntry type="inheritedJdk" />
-    <orderEntry type="sourceFolder" forTests="false" />
-  </component>
-</module>

.idea/laravel-plugin.xml

@@ -1,6 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<project version="4">
-  <component name="LaravelPluginSettings">
-    <option name="pluginEnabled" value="true" />
-  </component>
-</project>

.idea/misc.xml

@@ -1,25 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<project version="4">
-  <component name="JavaScriptSettings">
-    <option name="languageLevel" value="ES6" />
-  </component>
-  <component name="NodePackageJsonFileManager">
-    <packageJsonPaths />
-  </component>
-  <component name="ProjectInspectionProfilesVisibleTreeState">
-    <entry key="Project Default">
-      <profile-state>
-        <expanded-state>
-          <State>
-            <id />
-          </State>
-        </expanded-state>
-        <selected-state>
-          <State>
-            <id>Blade files</id>
-          </State>
-        </selected-state>
-      </profile-state>
-    </entry>
-  </component>
-</project>

.idea/modules.xml

@@ -1,8 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<project version="4">
-  <component name="ProjectModuleManager">
-    <modules>
-      <module fileurl="file://$PROJECT_DIR$/.idea/graph-tutorial.iml" filepath="$PROJECT_DIR$/.idea/graph-tutorial.iml" />
-    </modules>
-  </component>
-</project>

.idea/php.xml

@@ -23,7 +23,6 @@
       <path value="$PROJECT_DIR$/vendor/binsoul/net-mqtt" />
       <path value="$PROJECT_DIR$/vendor/opis/closure" />
       <path value="$PROJECT_DIR$/vendor/monolog/monolog" />
-      <path value="$PROJECT_DIR$/vendor/mgp25/instagram-php" />
       <path value="$PROJECT_DIR$/vendor/mockery/mockery" />
       <path value="$PROJECT_DIR$/vendor/symfony/console" />
       <path value="$PROJECT_DIR$/vendor/symfony/process" />
@@ -118,12 +117,58 @@
       <path value="$PROJECT_DIR$/vendor/doctrine/cache" />
       <path value="$PROJECT_DIR$/vendor/doctrine/event-manager" />
       <path value="$PROJECT_DIR$/vendor/doctrine/dbal" />
+      <path value="$PROJECT_DIR$/vendor/psr/cache" />
+      <path value="$PROJECT_DIR$/vendor/cache/tag-interop" />
+      <path value="$PROJECT_DIR$/vendor/cache/adapter-common" />
+      <path value="$PROJECT_DIR$/vendor/cache/filesystem-adapter" />
+      <path value="$PROJECT_DIR$/vendor/jaeger/g-http" />
+      <path value="$PROJECT_DIR$/vendor/jaeger/phpquery-single" />
+      <path value="$PROJECT_DIR$/vendor/jaeger/querylist" />
+      <path value="$PROJECT_DIR$/vendor/tightenco/collect" />
+      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-iconv" />
+      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-intl-idn" />
+      <path value="$PROJECT_DIR$/vendor/tinify/tinify" />
+      <path value="$PROJECT_DIR$/vendor/kylekatarnls/update-helper" />
+      <path value="$PROJECT_DIR$/vendor/psr/http-factory" />
+      <path value="$PROJECT_DIR$/vendor/symfony/service-contracts" />
+      <path value="$PROJECT_DIR$/vendor/symfony/mime" />
+      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-php73" />
+      <path value="$PROJECT_DIR$/vendor/symfony/event-dispatcher-contracts" />
+      <path value="$PROJECT_DIR$/vendor/symfony/translation-contracts" />
+      <path value="$PROJECT_DIR$/vendor/qcloud/cos-sdk-v5" />
+      <path value="$PROJECT_DIR$/vendor/mashape/unirest-php" />
+      <path value="$PROJECT_DIR$/vendor/phpfastcache/phpssdb" />
+      <path value="$PROJECT_DIR$/vendor/phpfastcache/phpfastcache" />
+      <path value="$PROJECT_DIR$/vendor/raiym/instagram-php-scraper" />
+      <path value="$PROJECT_DIR$/vendor/predis/predis" />
+      <path value="$PROJECT_DIR$/vendor/netresearch/jsonmapper" />
+      <path value="$PROJECT_DIR$/vendor/guzzlehttp/command" />
+      <path value="$PROJECT_DIR$/vendor/guzzlehttp/guzzle-services" />
+      <path value="$PROJECT_DIR$/vendor/symfony/error-handler" />
+      <path value="$PROJECT_DIR$/vendor/symfony/options-resolver" />
+      <path value="$PROJECT_DIR$/vendor/norkunas/youtube-dl-php" />
+      <path value="$PROJECT_DIR$/vendor/symfony/dom-crawler" />
+      <path value="$PROJECT_DIR$/vendor/encore/laravel-admin" />
+      <path value="$PROJECT_DIR$/vendor/phpseclib/phpseclib" />
+      <path value="$PROJECT_DIR$/vendor/firebase/php-jwt" />
+      <path value="$PROJECT_DIR$/vendor/google/auth" />
+      <path value="$PROJECT_DIR$/vendor/google/apiclient" />
+      <path value="$PROJECT_DIR$/vendor/google/apiclient-services" />
+      <path value="$PROJECT_DIR$/vendor/protoqol/prequel" />
+      <path value="$PROJECT_DIR$/vendor/nexmo/client-core" />
+      <path value="$PROJECT_DIR$/vendor/mgp25/instagram-php" />
+      <path value="$PROJECT_DIR$/vendor/mhor/php-mediainfo" />
+      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-php80" />
+      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-php70" />
+      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-intl-normalizer" />
+      <path value="$PROJECT_DIR$/vendor/league/mime-type-detection" />
+      <path value="$PROJECT_DIR$/vendor/symfony/deprecation-contracts" />
     </include_path>
   </component>
   <component name="PhpProjectSharedConfiguration" php_language_level="7.1" />
   <component name="PhpUnit">
     <phpunit_settings>
-      <PhpUnitSettings load_method="CUSTOM_LOADER" configuration_file_path="$PROJECT_DIR$/phpunit.xml" custom_loader_path="$PROJECT_DIR$/vendor/autoload.php" use_configuration_file="true" />
+      <PhpUnitSettings configuration_file_path="$PROJECT_DIR$/phpunit.xml" custom_loader_path="$PROJECT_DIR$/vendor/autoload.php" use_configuration_file="true" />
     </phpunit_settings>
   </component>
 </project>

.idea/workspace.xml

@@ -1,662 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<project version="4">
-  <component name="ChangeListManager">
-    <list default="true" id="f8883b6d-148e-4c06-b69b-206e09fe5251" name="Default Changelist" comment="" />
-    <option name="EXCLUDED_CONVERTED_TO_IGNORED" value="true" />
-    <option name="SHOW_DIALOG" value="false" />
-    <option name="HIGHLIGHT_CONFLICTS" value="true" />
-    <option name="HIGHLIGHT_NON_ACTIVE_CHANGELIST" value="false" />
-    <option name="LAST_RESOLUTION" value="IGNORE" />
-  </component>
-  <component name="ComposerSettings" doNotAsk="true" synchronizationState="SYNCHRONIZE">
-    <pharConfigPath>$PROJECT_DIR$/composer.json</pharConfigPath>
-  </component>
-  <component name="FileEditorManager">
-    <leaf>
-      <file pinned="false" current-in-tab="true">
-        <entry file="file://$PROJECT_DIR$/app/Http/Controllers/InstagramController.php">
-          <provider selected="true" editor-type-id="text-editor">
-            <state relative-caret-position="1081">
-              <caret line="47" column="27" lean-forward="true" selection-start-line="47" selection-start-column="27" selection-end-line="47" selection-end-column="27" />
-              <folding>
-                <element signature="e#40#58#0#PHP" expanded="true" />
-              </folding>
-            </state>
-          </provider>
-        </entry>
-      </file>
-    </leaf>
-  </component>
-  <component name="IdeDocumentHistory">
-    <option name="CHANGED_PATHS">
-      <list>
-        <option value="$PROJECT_DIR$/database/migrations/2019_01_31_022647_create_instagrams_table.php" />
-        <option value="$PROJECT_DIR$/resources/views/layout.blade.php" />
-        <option value="$PROJECT_DIR$/routes/web.php" />
-        <option value="$PROJECT_DIR$/database/migrations/2019_01_31_022647_create_instagram_table.php" />
-        <option value="$PROJECT_DIR$/database/migrations/2019_02_06_232019_add_index_to_instagram.php" />
-        <option value="$PROJECT_DIR$/app/Console/Kernel.php" />
-        <option value="$PROJECT_DIR$/app/Instagram.php" />
-        <option value="$PROJECT_DIR$/app/Services/InstagramService.php" />
-        <option value="$PROJECT_DIR$/.env" />
-        <option value="$PROJECT_DIR$/app/Http/Controllers/InstagramController.php" />
-      </list>
-    </option>
-  </component>
-  <component name="PackageJsonUpdateNotifier">
-    <dismissed value="$PROJECT_DIR$/package.json" />
-  </component>
-  <component name="PhpServers">
-    <servers />
-  </component>
-  <component name="PhpWorkspaceProjectConfiguration">
-    <include_path>
-      <path value="$PROJECT_DIR$/vendor/erusev/parsedown" />
-      <path value="$PROJECT_DIR$/vendor/league/oauth2-client" />
-      <path value="$PROJECT_DIR$/vendor/league/flysystem" />
-      <path value="$PROJECT_DIR$/vendor/jakub-onderka/php-console-highlighter" />
-      <path value="$PROJECT_DIR$/vendor/jakub-onderka/php-console-color" />
-      <path value="$PROJECT_DIR$/vendor/phpspec/prophecy" />
-      <path value="$PROJECT_DIR$/vendor/corneltek/getoptionkit" />
-      <path value="$PROJECT_DIR$/vendor/ringcentral/psr7" />
-      <path value="$PROJECT_DIR$/vendor/filp/whoops" />
-      <path value="$PROJECT_DIR$/vendor/phpdocumentor/reflection-docblock" />
-      <path value="$PROJECT_DIR$/vendor/myclabs/deep-copy" />
-      <path value="$PROJECT_DIR$/vendor/phpdocumentor/type-resolver" />
-      <path value="$PROJECT_DIR$/vendor/phpdocumentor/reflection-common" />
-      <path value="$PROJECT_DIR$/vendor/vlucas/phpdotenv" />
-      <path value="$PROJECT_DIR$/vendor/winbox/args" />
-      <path value="$PROJECT_DIR$/vendor/swiftmailer/swiftmailer" />
-      <path value="$PROJECT_DIR$/vendor/binsoul/net-mqtt-client-react" />
-      <path value="$PROJECT_DIR$/vendor/evenement/evenement" />
-      <path value="$PROJECT_DIR$/vendor/binsoul/net-mqtt" />
-      <path value="$PROJECT_DIR$/vendor/opis/closure" />
-      <path value="$PROJECT_DIR$/vendor/monolog/monolog" />
-      <path value="$PROJECT_DIR$/vendor/mgp25/instagram-php" />
-      <path value="$PROJECT_DIR$/vendor/mockery/mockery" />
-      <path value="$PROJECT_DIR$/vendor/symfony/console" />
-      <path value="$PROJECT_DIR$/vendor/symfony/process" />
-      <path value="$PROJECT_DIR$/vendor/fideloper/proxy" />
-      <path value="$PROJECT_DIR$/vendor/symfony/debug" />
-      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-php72" />
-      <path value="$PROJECT_DIR$/vendor/symfony/http-kernel" />
-      <path value="$PROJECT_DIR$/vendor/symfony/contracts" />
-      <path value="$PROJECT_DIR$/vendor/symfony/finder" />
-      <path value="$PROJECT_DIR$/vendor/phar-io/manifest" />
-      <path value="$PROJECT_DIR$/vendor/symfony/routing" />
-      <path value="$PROJECT_DIR$/vendor/phar-io/version" />
-      <path value="$PROJECT_DIR$/vendor/symfony/event-dispatcher" />
-      <path value="$PROJECT_DIR$/vendor/symfony/css-selector" />
-      <path value="$PROJECT_DIR$/vendor/microsoft/microsoft-graph" />
-      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-ctype" />
-      <path value="$PROJECT_DIR$/vendor/symfony/translation" />
-      <path value="$PROJECT_DIR$/vendor/symfony/polyfill-mbstring" />
-      <path value="$PROJECT_DIR$/vendor/symfony/http-foundation" />
-      <path value="$PROJECT_DIR$/vendor/composer" />
-      <path value="$PROJECT_DIR$/vendor/phpunit/php-timer" />
-      <path value="$PROJECT_DIR$/vendor/phpunit/php-file-iterator" />
-      <path value="$PROJECT_DIR$/vendor/phpunit/php-text-template" />
-      <path value="$PROJECT_DIR$/vendor/paragonie/random_compat" />
-      <path value="$PROJECT_DIR$/vendor/phpunit/php-token-stream" />
-      <path value="$PROJECT_DIR$/vendor/zendframework/zend-diactoros" />
-      <path value="$PROJECT_DIR$/vendor/phpunit/php-code-coverage" />
-      <path value="$PROJECT_DIR$/vendor/dnoegel/php-xdg-base-dir" />
-      <path value="$PROJECT_DIR$/vendor/lcobucci/jwt" />
-      <path value="$PROJECT_DIR$/vendor/psy/psysh" />
-      <path value="$PROJECT_DIR$/vendor/phpunit/phpunit" />
-      <path value="$PROJECT_DIR$/vendor/nikic/php-parser" />
-      <path value="$PROJECT_DIR$/vendor/ralouphie/getallheaders" />
-      <path value="$PROJECT_DIR$/vendor/egulias/email-validator" />
-      <path value="$PROJECT_DIR$/vendor/theseer/tokenizer" />
-      <path value="$PROJECT_DIR$/vendor/guzzlehttp/guzzle" />
-      <path value="$PROJECT_DIR$/vendor/lazyjsonmapper/lazyjsonmapper" />
-      <path value="$PROJECT_DIR$/vendor/guzzlehttp/psr7" />
-      <path value="$PROJECT_DIR$/vendor/guzzlehttp/promises" />
-      <path value="$PROJECT_DIR$/vendor/symfony/var-dumper" />
-      <path value="$PROJECT_DIR$/vendor/psr/container" />
-      <path value="$PROJECT_DIR$/vendor/psr/http-message" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/global-state" />
-      <path value="$PROJECT_DIR$/vendor/psr/log" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/comparator" />
-      <path value="$PROJECT_DIR$/vendor/psr/simple-cache" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/environment" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/exporter" />
-      <path value="$PROJECT_DIR$/vendor/nesbot/carbon" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/recursion-context" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/object-enumerator" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/object-reflector" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/resource-operations" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/code-unit-reverse-lookup" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/diff" />
-      <path value="$PROJECT_DIR$/vendor/sebastian/version" />
-      <path value="$PROJECT_DIR$/vendor/react/cache" />
-      <path value="$PROJECT_DIR$/vendor/react/stream" />
-      <path value="$PROJECT_DIR$/vendor/react/dns" />
-      <path value="$PROJECT_DIR$/vendor/react/promise-timer" />
-      <path value="$PROJECT_DIR$/vendor/react/promise" />
-      <path value="$PROJECT_DIR$/vendor/react/socket" />
-      <path value="$PROJECT_DIR$/vendor/react/event-loop" />
-      <path value="$PROJECT_DIR$/vendor/webmozart/assert" />
-      <path value="$PROJECT_DIR$/vendor/beyondcode/laravel-dump-server" />
-      <path value="$PROJECT_DIR$/vendor/doctrine/instantiator" />
-      <path value="$PROJECT_DIR$/vendor/doctrine/inflector" />
-      <path value="$PROJECT_DIR$/vendor/doctrine/lexer" />
-      <path value="$PROJECT_DIR$/vendor/fzaninotto/faker" />
-      <path value="$PROJECT_DIR$/vendor/hamcrest/hamcrest-php" />
-      <path value="$PROJECT_DIR$/vendor/laravel/tinker" />
-      <path value="$PROJECT_DIR$/vendor/laravel/framework" />
-      <path value="$PROJECT_DIR$/vendor/laravel/nexmo-notification-channel" />
-      <path value="$PROJECT_DIR$/vendor/laravel/slack-notification-channel" />
-      <path value="$PROJECT_DIR$/vendor/valga/fbns-react" />
-      <path value="$PROJECT_DIR$/vendor/tijsverkoyen/css-to-inline-styles" />
-      <path value="$PROJECT_DIR$/vendor/php-http/guzzle6-adapter" />
-      <path value="$PROJECT_DIR$/vendor/php-http/httplug" />
-      <path value="$PROJECT_DIR$/vendor/php-http/promise" />
-      <path value="$PROJECT_DIR$/vendor/dragonmantank/cron-expression" />
-      <path value="$PROJECT_DIR$/vendor/clue/http-proxy-react" />
-      <path value="$PROJECT_DIR$/vendor/clue/socks-react" />
-      <path value="$PROJECT_DIR$/vendor/nunomaduro/collision" />
-      <path value="$PROJECT_DIR$/vendor/nexmo/client" />
-      <path value="$PROJECT_DIR$/vendor/ramsey/uuid" />
-      <path value="$PROJECT_DIR$/vendor/symfony/filesystem" />
-      <path value="$PROJECT_DIR$/vendor/seld/phar-utils" />
-      <path value="$PROJECT_DIR$/vendor/seld/jsonlint" />
-      <path value="$PROJECT_DIR$/vendor/barryvdh/reflection-docblock" />
-      <path value="$PROJECT_DIR$/vendor/barryvdh/laravel-ide-helper" />
-      <path value="$PROJECT_DIR$/vendor/justinrainbow/json-schema" />
-      <path value="$PROJECT_DIR$/vendor/doctrine/cache" />
-      <path value="$PROJECT_DIR$/vendor/doctrine/event-manager" />
-      <path value="$PROJECT_DIR$/vendor/doctrine/dbal" />
-    </include_path>
-  </component>
-  <component name="ProjectFrameBounds" extendedState="6">
-    <option name="x" value="-6" />
-    <option name="y" value="23" />
-    <option name="width" value="1286" />
-    <option name="height" value="772" />
-  </component>
-  <component name="ProjectView">
-    <navigator proportions="" version="1">
-      <foldersAlwaysOnTop value="true" />
-    </navigator>
-    <panes>
-      <pane id="Scope" />
-      <pane id="ProjectPane">
-        <subPane>
-          <expand>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="app" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="app" type="462c0819:PsiDirectoryNode" />
-              <item name="Console" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="app" type="462c0819:PsiDirectoryNode" />
-              <item name="Http" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="app" type="462c0819:PsiDirectoryNode" />
-              <item name="Http" type="462c0819:PsiDirectoryNode" />
-              <item name="Controllers" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="app" type="462c0819:PsiDirectoryNode" />
-              <item name="Providers" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="app" type="462c0819:PsiDirectoryNode" />
-              <item name="Services" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="app" type="462c0819:PsiDirectoryNode" />
-              <item name="TokenStore" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="database" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="database" type="462c0819:PsiDirectoryNode" />
-              <item name="migrations" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="vendor" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="vendor" type="462c0819:PsiDirectoryNode" />
-              <item name="microsoft" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="vendor" type="462c0819:PsiDirectoryNode" />
-              <item name="microsoft" type="462c0819:PsiDirectoryNode" />
-              <item name="microsoft-graph" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="vendor" type="462c0819:PsiDirectoryNode" />
-              <item name="microsoft" type="462c0819:PsiDirectoryNode" />
-              <item name="microsoft-graph" type="462c0819:PsiDirectoryNode" />
-              <item name="src" type="462c0819:PsiDirectoryNode" />
-            </path>
-            <path>
-              <item name="graph-tutorial" type="b2602c69:ProjectViewProjectNode" />
-              <item name="graph-tutorial" type="462c0819:PsiDirectoryNode" />
-              <item name="vendor" type="462c0819:PsiDirectoryNode" />
-              <item name="microsoft" type="462c0819:PsiDirectoryNode" />
-              <item name="microsoft-graph" type="462c0819:PsiDirectoryNode" />
-              <item name="src" type="462c0819:PsiDirectoryNode" />
-              <item name="Http" type="462c0819:PsiDirectoryNode" />
-            </path>
-          </expand>
-          <select />
-        </subPane>
-      </pane>
-    </panes>
-  </component>
-  <component name="PropertiesComponent">
-    <property name="WebServerToolWindowFactoryState" value="false" />
-    <property name="last_opened_file_path" value="$PROJECT_DIR$" />
-    <property name="nodejs_interpreter_path.stuck_in_default_project" value="undefined stuck path" />
-    <property name="nodejs_npm_path_reset_for_default_project" value="true" />
-    <property name="nodejs_package_manager_path" value="yarn" />
-    <property name="settings.editor.selected.configurable" value="preferences.sourceCode.Other File Types" />
-    <property name="settings.editor.splitter.proportion" value="0.2" />
-  </component>
-  <component name="RunDashboard">
-    <option name="ruleStates">
-      <list>
-        <RuleState>
-          <option name="name" value="ConfigurationTypeDashboardGroupingRule" />
-        </RuleState>
-        <RuleState>
-          <option name="name" value="StatusDashboardGroupingRule" />
-        </RuleState>
-      </list>
-    </option>
-  </component>
-  <component name="RunManager">
-    <configuration name="phpunit.xml" type="PHPUnitRunConfigurationType" factoryName="PHPUnit">
-      <TestRunner scope="XML" />
-      <method v="2" />
-    </configuration>
-  </component>
-  <component name="SvnConfiguration">
-    <configuration />
-  </component>
-  <component name="TaskManager">
-    <task active="true" id="Default" summary="Default task">
-      <changelist id="f8883b6d-148e-4c06-b69b-206e09fe5251" name="Default Changelist" comment="" />
-      <created>1547951556931</created>
-      <option name="number" value="Default" />
-      <option name="presentableId" value="Default" />
-      <updated>1547951556931</updated>
-      <workItem from="1547951560469" duration="1616000" />
-      <workItem from="1548863591622" duration="700000" />
-      <workItem from="1548900350914" duration="3669000" />
-      <workItem from="1548916931914" duration="1836000" />
-      <workItem from="1548926324347" duration="4453000" />
-      <workItem from="1548947422088" duration="2917000" />
-      <workItem from="1549036581486" duration="291000" />
-      <workItem from="1549157679604" duration="6501000" />
-      <workItem from="1549520613895" duration="12874000" />
-    </task>
-    <servers />
-  </component>
-  <component name="TimeTrackingManager">
-    <option name="totallyTimeSpent" value="34857000" />
-  </component>
-  <component name="ToolWindowManager">
-    <frame x="0" y="23" width="1280" height="777" extended-state="6" />
-    <layout>
-      <window_info content_ui="combo" id="Project" order="0" visible="true" weight="0.28109854" />
-      <window_info id="Structure" order="1" side_tool="true" weight="0.25" />
-      <window_info id="npm" order="2" side_tool="true" />
-      <window_info id="Favorites" order="3" side_tool="true" />
-      <window_info anchor="bottom" id="Message" order="0" />
-      <window_info anchor="bottom" id="Find" order="1" />
-      <window_info anchor="bottom" id="Run" order="2" />
-      <window_info anchor="bottom" id="Debug" order="3" weight="0.4" />
-      <window_info anchor="bottom" id="Cvs" order="4" weight="0.25" />
-      <window_info anchor="bottom" id="Inspection" order="5" weight="0.4" />
-      <window_info anchor="bottom" id="TODO" order="6" />
-      <window_info anchor="bottom" id="Docker" order="7" show_stripe_button="false" />
-      <window_info anchor="bottom" id="Version Control" order="8" />
-      <window_info anchor="bottom" id="Database Changes" order="9" />
-      <window_info anchor="bottom" id="Event Log" order="10" side_tool="true" />
-      <window_info active="true" anchor="bottom" id="Terminal" order="11" visible="true" weight="0.26158446" />
-      <window_info anchor="right" id="Commander" order="0" weight="0.4" />
-      <window_info anchor="right" id="Ant Build" order="1" weight="0.25" />
-      <window_info anchor="right" content_ui="combo" id="Hierarchy" order="2" weight="0.25" />
-      <window_info anchor="right" id="Database" order="3" />
-    </layout>
-  </component>
-  <component name="TypeScriptGeneratedFilesManager">
-    <option name="version" value="1" />
-  </component>
-  <component name="editorHistoryManager">
-    <entry file="file://$PROJECT_DIR$/vendor/nikic/php-parser/README.md">
-      <provider selected="true" editor-type-id="split-provider[text-editor;markdown-preview-editor]">
-        <state split_layout="SPLIT">
-          <first_editor />
-          <second_editor />
-        </state>
-      </provider>
-    </entry>
-    <entry file="jar://$APPLICATION_HOME_DIR$/plugins/php/lib/php.jar!/stubs/standard/basic.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="286">
-          <caret line="144" column="9" selection-start-line="144" selection-start-column="9" selection-end-line="144" selection-end-column="9" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/routes/console.php">
-      <provider selected="true" editor-type-id="text-editor" />
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Http/Controllers/AuthController.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="-1631" />
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Http/Controllers/Auth/ForgotPasswordController.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="471">
-          <caret line="29" column="21" lean-forward="true" selection-start-line="29" selection-start-column="21" selection-end-line="29" selection-end-column="21" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/laravel/framework/src/Illuminate/Routing/Controller.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="222">
-          <caret line="22" column="20" selection-start-line="22" selection-start-column="20" selection-end-line="22" selection-end-column="20" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/tests/CreatesApplication.php">
-      <provider selected="true" editor-type-id="text-editor" />
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Http/Controllers/Controller.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="230">
-          <caret line="13" column="34" lean-forward="true" selection-start-line="13" selection-start-column="34" selection-end-line="13" selection-end-column="34" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/composer.json">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="259">
-          <caret line="22" column="34" lean-forward="true" selection-start-line="22" selection-start-column="34" selection-end-line="22" selection-end-column="34" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/config/queue.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="415">
-          <caret line="81" column="26" lean-forward="true" selection-start-line="81" selection-start-column="26" selection-end-line="81" selection-end-column="26" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/config/database.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="1702">
-          <caret line="74" column="26" lean-forward="true" selection-start-line="74" selection-start-column="26" selection-end-line="74" selection-end-column="26" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/resources/views/layout.blade.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="326">
-          <caret line="35" column="115" selection-start-line="35" selection-start-column="115" selection-end-line="35" selection-end-column="115" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/routes/web.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="161">
-          <caret line="7" column="54" selection-start-line="7" selection-start-column="54" selection-end-line="7" selection-end-column="54" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/TokenStore/TokenCache.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="23">
-          <caret line="40" column="39" lean-forward="true" selection-start-line="40" selection-start-column="39" selection-end-line="40" selection-end-column="39" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/microsoft/microsoft-graph/src/Http/GraphResponse.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="175">
-          <caret line="136" column="20" selection-start-line="136" selection-start-column="20" selection-end-line="136" selection-end-column="20" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/microsoft/microsoft-graph/src/Model/Event.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="163">
-          <caret line="26" column="6" selection-start-line="26" selection-start-column="6" selection-end-line="26" selection-end-column="6" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Http/Controllers/CalendarController.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="161">
-          <caret line="7" column="18" lean-forward="true" selection-start-line="7" selection-end-line="8" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/resources/views/calendar.blade.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="391">
-          <caret line="17" column="29" selection-start-line="17" selection-start-column="29" selection-end-line="17" selection-end-column="29" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/resources/views/welcome.blade.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="207">
-          <caret line="9" column="7" lean-forward="true" selection-start-line="9" selection-start-column="7" selection-end-line="9" selection-end-column="7" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/artisan">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="289">
-          <caret line="35" column="53" selection-start-line="35" selection-start-column="53" selection-end-line="35" selection-end-column="53" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/symfony/console/Input/ArgvInput.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="-6337">
-          <caret line="49" column="20" selection-start-line="49" selection-start-column="20" selection-end-line="49" selection-end-column="20" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/database/migrations/2019_01_31_022647_create_instagram_table.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="284">
-          <caret line="23" column="32" lean-forward="true" selection-start-line="23" selection-end-line="24" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/laravel/framework/src/Illuminate/Database/Schema/Blueprint.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="170">
-          <caret line="500" column="20" selection-start-line="500" selection-start-column="20" selection-end-line="500" selection-end-column="20" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/database/migrations/2019_02_06_232019_add_index_to_instagram.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="307">
-          <caret line="22" column="7" lean-forward="true" selection-start-line="22" selection-start-column="7" selection-end-line="22" selection-end-column="7" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Http/Controllers/HomeController.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="345">
-          <caret line="15" lean-forward="true" selection-start-line="15" selection-end-line="15" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/_ide_helper.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="218">
-          <caret line="13654" column="60" selection-start-line="13654" selection-start-column="49" selection-end-line="13654" selection-end-column="60" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Console/Kernel.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="219">
-          <caret line="31" column="35" selection-start-line="31" selection-start-column="35" selection-end-line="31" selection-end-column="35" />
-          <folding>
-            <element signature="e#31#74#0#PHP" expanded="true" />
-          </folding>
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Instagram.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="198">
-          <caret line="21" lean-forward="true" selection-start-line="21" selection-end-line="21" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/mgp25/instagram-php/src/Request.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="200">
-          <caret line="211" column="20" selection-start-line="211" selection-start-column="20" selection-end-line="211" selection-end-column="20" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="jar://$APPLICATION_HOME_DIR$/plugins/php/lib/php.jar!/stubs/standard/standard_5.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="119">
-          <caret line="1057" column="9" selection-start-line="1057" selection-start-column="9" selection-end-line="1057" selection-end-column="9" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/mgp25/instagram-php/src/Request/Timeline.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="-87">
-          <caret line="316" column="20" selection-start-line="316" selection-start-column="20" selection-end-line="316" selection-end-column="20" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Services/InstagramService.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="127">
-          <caret line="220" column="33" lean-forward="true" selection-start-line="220" selection-start-column="33" selection-end-line="220" selection-end-column="33" />
-          <folding>
-            <element signature="e#86#123#0#PHP" expanded="true" />
-          </folding>
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/.env">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="272">
-          <caret line="44" column="69" selection-start-line="44" selection-start-column="69" selection-end-line="44" selection-end-column="69" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/microsoft/microsoft-graph/src/Model/Entity.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="23">
-          <caret line="26" column="6" selection-start-line="26" selection-start-column="6" selection-end-line="26" selection-end-column="6" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/microsoft/microsoft-graph/src/Model/BaseItem.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="159">
-          <caret line="26" column="26" selection-start-line="26" selection-start-column="26" selection-end-line="26" selection-end-column="26" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/microsoft/microsoft-graph/src/Model/DriveItem.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="159">
-          <caret line="26" column="28" selection-start-line="26" selection-start-column="28" selection-end-line="26" selection-end-column="28" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/symfony/var-dumper/Resources/functions/dump.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="164">
-          <caret line="17" column="13" selection-start-line="17" selection-start-column="13" selection-end-line="17" selection-end-column="13" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/microsoft/microsoft-graph/src/Http/GraphRequest.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="23">
-          <caret line="112" column="20" selection-start-line="112" selection-start-column="20" selection-end-line="112" selection-end-column="20" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/vendor/microsoft/microsoft-graph/src/Graph.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="96">
-          <caret line="137" column="20" selection-start-line="137" selection-start-column="20" selection-end-line="137" selection-end-column="20" />
-        </state>
-      </provider>
-    </entry>
-    <entry file="file://$PROJECT_DIR$/app/Http/Controllers/InstagramController.php">
-      <provider selected="true" editor-type-id="text-editor">
-        <state relative-caret-position="1081">
-          <caret line="47" column="27" lean-forward="true" selection-start-line="47" selection-start-column="27" selection-end-line="47" selection-end-column="27" />
-          <folding>
-            <element signature="e#40#58#0#PHP" expanded="true" />
-          </folding>
-        </state>
-      </provider>
-    </entry>
-  </component>
-  <component name="masterDetails">
-    <states>
-      <state key="ScopeChooserConfigurable.UI">
-        <settings>
-          <splitter-proportions>
-            <option name="proportions">
-              <list>
-                <option value="0.2" />
-              </list>
-            </option>
-          </splitter-proportions>
-        </settings>
-      </state>
-    </states>
-  </component>
-</project>

1-2.html

@@ -0,0 +1,198 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+<meta http-equiv="Cache-Control" content="no-transform" />
+<meta http-equiv="Cache-Control" content="no-siteapp" />
+<meta name="applicable-device" content="pc">
+<title>beautyleg,beautyleg套图,beautyleg美腿写真-爱死美女-mm24.cc</title>
+<meta name="keywords" content="beautyleg,beautyleg套图,beautyleg美腿写真">
+<meta name="description" content="台湾美腿女郎系列 Beautyleg是台湾一家以美腿写真为主的腿模影音电子杂志媒体，Beautyleg系列以美腿著称，Beautyleg台湾的模特居多同时模特的气质上佳。Beautyleg发布有：Beautyleg新闻图片、美腿套图、写真视频 爱秀美女图片站">
+<link href="/css/meitulu.css" rel="stylesheet" type="text/css" />
+<link rel="icon" href="/ico.ico" type="image/x-icon" />
+</head>
+<body>
+<div class="header">
+<div class="top">
+    <div class="logo"><a href="https://www.mm24.cc/"><img src="/logo.png" alt="爱死美女" /></a></div>
+    <div class="nav">
+    	        	<ul class="menu">
+			<li><a href="https://www.mm24.cc/">首页</a></li>
+            <li><a href="https://www.mm24.cc/taotu/"><span>套图</span></a>
+        <ul id="tag_ul">
+          <li><a href="https://www.mm24.cc/taotu/2020/">2020</a></li>
+          <li><a href="https://www.mm24.cc/taotu/2019/">2019</a></li>
+          <li><a href="https://www.mm24.cc/taotu/2018/">2018</a></li>
+<li><a href="https://www.mm24.cc/taotu/2017/">2017</a></li>
+<li><a href="https://www.mm24.cc/taotu/2016/">2016</a></li>
+<li><a href="https://www.mm24.cc/taotu/2015/">2015</a></li>
+<li><a href="https://www.mm24.cc/taotu/2014/">2014</a></li>
+<li><a href="https://www.mm24.cc/taotu/2013/">2013</a></li>
+<li><a href="https://www.mm24.cc/taotu/2012/">2012</a></li>
+<li><a href="https://www.mm24.cc/taotu/2011/">2011</a></li>
+<li><a href="https://www.mm24.cc/taotu/2010/">2010</a></li>
+<li><a href="https://www.mm24.cc/taotu/2009/">2009</a></li>
+<li><a href="https://www.mm24.cc/taotu/2008/">2008</a></li>
+<li><a href="https://www.mm24.cc/taotu/2007/">2007</a></li>
+<li><a href="https://www.mm24.cc/taotu/2006/">2006</a></li>
+<li><a href="https://www.mm24.cc/taotu/2005/">2005</a></li>
+</ul>
+ </li>
+ <li><a href="https://www.mm24.cc/shipin/"><span>视频</span></a>
+        <ul id="tag_ul">
+          <li><a href="https://www.mm24.cc/shipin/2019/">2019</a></li>
+          <li><a href="https://www.mm24.cc/shipin/2018/">2018</a></li>
+<li><a href="https://www.mm24.cc/shipin/2017/">2017</a></li>
+<li><a href="https://www.mm24.cc/shipin/2016/">2016</a></li>
+<li><a href="https://www.mm24.cc/shipin/2015/">2015</a></li>
+<li><a href="https://www.mm24.cc/shipin/2014/">2014</a></li>
+<li><a href="https://www.mm24.cc/shipin/2013/">2013</a></li>
+<li><a href="https://www.mm24.cc/shipin/2012/">2012</a></li>
+<li><a href="https://www.mm24.cc/shipin/2011/">2011</a></li>
+<li><a href="https://www.mm24.cc/shipin/2010/">2010</a></li>
+<li><a href="https://www.mm24.cc/shipin/2009/">2009</a></li>
+<li><a href="https://www.mm24.cc/shipin/2008/">2008</a></li>
+</ul>
+ </li>
+			<li><a href="https://www.mm24.cc/ligui/">丽柜</a></li>
+             <li><a href="http://www.neiwai.cc">福利</a></li>
+		
+			
+			            
+            <li class="search"><form method=post action=/plus/search.php>
+<INPUT onfocus="this.value=''" value='' type=text name=keyword><INPUT id=search_submit value=搜索 type=submit></form></li>
+            </ul>
+            </div> 
+</div>
+</div>
+<div class="main">
+<div class="bk10"><script src="/ad/list-1.js" type="text/javascript"></script></div>
+<div class="boxs">
+<ul class="img">
+<li><a href="/taotu/2019/3049.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/200106/1-2001062322050-L.jpg" alt="Beautyleg 2019.12.30 No.1860 Abby"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3049.html" target="_blank">Beautyleg 2019.12.30 No.1860 Abby</a></p></li><li><a href="/taotu/2019/3048.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191229/1-1912291539480-L.jpg" alt="Beautyleg 2019.12.27 No.1859 Stephy"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3048.html" target="_blank">Beautyleg 2019.12.27 No.1859 Stephy</a></p></li><li><a href="/taotu/2019/3047.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191229/1-1912291536050-L.jpg" alt="Beautyleg 2019.12.25 No.1858 Xin"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3047.html" target="_blank">Beautyleg 2019.12.25 No.1858 Xin</a></p></li><li><a href="/taotu/2019/3046.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191229/1-1912291530390-L.jpg" alt="Beautyleg 2019.12.23 No.1857 Lola"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3046.html" target="_blank">Beautyleg 2019.12.23 No.1857 Lola</a></p></li><li><a href="/taotu/2019/3040.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191222/1-1912220051340-L.jpg" alt="Beautyleg 2019.12.20 No.1856 Cathy"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3040.html" target="_blank">Beautyleg 2019.12.20 No.1856 Cathy</a></p></li><li><a href="/taotu/2019/3039.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191222/1-1912220040390-L.jpg" alt="Beautyleg 2019.12.18 No.1855 Perri"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3039.html" target="_blank">Beautyleg 2019.12.18 No.1855 Perri</a></p></li><li><a href="/taotu/2019/3038.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191222/1-1912220030430-L.jpg" alt="Beautyleg 2019.12.16 No.1854 Flora"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3038.html" target="_blank">Beautyleg 2019.12.16 No.1854 Flora</a></p></li><li><a href="/taotu/2019/3037.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191222/1-1912220030050-L.jpg" alt="Beautyleg 2019.12.15 No.1853 Anonymity"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3037.html" target="_blank">Beautyleg 2019.12.15 No.1853 Anonymity</a></p></li><li><a href="/taotu/2019/3033.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191216/1-1912162106020-L.jpg" alt="Beautyleg 2019.12.13 No.1852 Vanessa"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3033.html" target="_blank">Beautyleg 2019.12.13 No.1852 Vanessa</a></p></li><li><a href="/taotu/2019/3032.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191216/1-191216204Z30-L.jpg" alt="Beautyleg 2019.12.11 No.1851 Olivia"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3032.html" target="_blank">Beautyleg 2019.12.11 No.1851 Olivia</a></p></li><li><a href="/taotu/2019/3031.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191216/1-1912162032440-L.jpg" alt="Beautyleg 2019.12.09 No.1850 Dora"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3031.html" target="_blank">Beautyleg 2019.12.09 No.1850 Dora</a></p></li><li><a href="/taotu/2019/3030.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191207/1-19120H214260-L.jpg" alt="Beautyleg 2019.12.06 No.1849 Stephy"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3030.html" target="_blank">Beautyleg 2019.12.06 No.1849 Stephy</a></p></li><li><a href="/taotu/2019/3023.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191204/1-1912042216010-L.jpg" alt="Beautyleg 2019.12.02 No.1848 Yun"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3023.html" target="_blank">Beautyleg 2019.12.02 No.1848 Yun</a></p></li><li><a href="/taotu/2019/3022.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191204/1-191204220A70-L.jpg" alt="Beautyleg 2019.11.29 No.1847 Emma"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3022.html" target="_blank">Beautyleg 2019.11.29 No.1847 Emma</a></p></li><li><a href="/taotu/2019/3015.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191127/1-19112H343140-L.jpg" alt="Beautyleg 2019.11.27 No.1846 Amber"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3015.html" target="_blank">Beautyleg 2019.11.27 No.1846 Amber</a></p></li><li><a href="/taotu/2019/3014.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191127/1-19112H336420-L.jpg" alt="Beautyleg 2019.11.25 No.1845 Chu"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3014.html" target="_blank">Beautyleg 2019.11.25 No.1845 Chu</a></p></li><li><a href="/taotu/2019/3013.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191127/1-19112H333120-L.jpg" alt="Beautyleg 2019.11.22 No.1844 Yoyo"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3013.html" target="_blank">Beautyleg 2019.11.22 No.1844 Yoyo</a></p></li><li><a href="/taotu/2019/3012.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191120/1-1911202133010-L.jpg" alt="Beautyleg 2019.11.18 No.1843 Celia"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3012.html" target="_blank">Beautyleg 2019.11.18 No.1843 Celia</a></p></li><li><a href="/taotu/2019/3011.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191120/1-191120212G20-L.jpg" alt="Beautyleg 2019.11.15 No.1842 Avril"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3011.html" target="_blank">Beautyleg 2019.11.15 No.1842 Avril</a></p></li><li><a href="/taotu/2019/3006.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191117/1-19111G63G20-L.jpg" alt="Beautyleg 2019.11.13 No.1841 Sharon"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3006.html" target="_blank">Beautyleg 2019.11.13 No.1841 Sharon</a></p></li><li><a href="/taotu/2019/3005.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191117/1-19111G636290-L.jpg" alt="Beautyleg 2019.11.11 No.1840 Dora"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3005.html" target="_blank">Beautyleg 2019.11.11 No.1840 Dora</a></p></li><li><a href="/taotu/2019/3000.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191108/1-19110R039380-L.jpg" alt="Beautyleg 2019.11.08 No.1839 Tina"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/3000.html" target="_blank">Beautyleg 2019.11.08 No.1839 Tina</a></p></li><li><a href="/taotu/2019/2993.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191106/1-1911061G6250-L.jpg" alt="Beautyleg 2019.11.04 No.1838 Leonie"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2993.html" target="_blank">Beautyleg 2019.11.04 No.1838 Leonie</a></p></li><li><a href="/taotu/2019/2992.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191106/1-1911061G4590-L.jpg" alt="Beautyleg 2019.11.01 No.1837 Shacy"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2992.html" target="_blank">Beautyleg 2019.11.01 No.1837 Shacy</a></p></li><li><a href="/taotu/2019/2979.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191031/1-1910312030090-L.jpg" alt="Beautyleg 2019.10.30 No.1836 Michelle"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2979.html" target="_blank">Beautyleg 2019.10.30 No.1836 Michelle</a></p></li><li><a href="/taotu/2019/2978.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191031/1-191031202T10-L.jpg" alt="Beautyleg 2019.10.28 No.1835 Emily"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2978.html" target="_blank">Beautyleg 2019.10.28 No.1835 Emily</a></p></li><li><a href="/taotu/2019/2977.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191031/1-191031202I90-L.jpg" alt="Beautyleg 2019.10.25 No.1834 Yoyo"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2977.html" target="_blank">Beautyleg 2019.10.25 No.1834 Yoyo</a></p></li><li><a href="/taotu/2019/2972.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191024/1-1910240040070-L.jpg" alt="Beautyleg 2019.10.23 No.1833 Kaylar"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2972.html" target="_blank">Beautyleg 2019.10.23 No.1833 Kaylar</a></p></li><li><a href="/taotu/2019/2971.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191024/1-191024003R60-L.jpg" alt="Beautyleg 2019.10.21 No.1832 Tina"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2971.html" target="_blank">Beautyleg 2019.10.21 No.1832 Tina</a></p></li><li><a href="/taotu/2019/2970.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191024/1-191024003H80-L.jpg" alt="Beautyleg 2019.10.18 No.1831 Avril"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2970.html" target="_blank">Beautyleg 2019.10.18 No.1831 Avril</a></p></li><li><a href="/taotu/2019/2963.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191015/1-1910152211490-L.jpg" alt="Beautyleg 2019.10.14 No.1830 Winnie"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2963.html" target="_blank">Beautyleg 2019.10.14 No.1830 Winnie</a></p></li><li><a href="/taotu/2019/2962.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191015/1-1910152205530-L.jpg" alt="Beautyleg 2019.10.11 No.1829 ChiChi"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2962.html" target="_blank">Beautyleg 2019.10.11 No.1829 ChiChi</a></p></li><li><a href="/taotu/2019/2956.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191009/1-1910092036340-L.jpg" alt="Beautyleg 2019.10.09 No.1828 Yvonne"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2956.html" target="_blank">Beautyleg 2019.10.09 No.1828 Yvonne</a></p></li><li><a href="/taotu/2019/2955.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191009/1-1910092035450-L.jpg" alt="Beautyleg 2019.10.07 No.1827 Wendy"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2955.html" target="_blank">Beautyleg 2019.10.07 No.1827 Wendy</a></p></li><li><a href="/taotu/2019/2954.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191009/1-1910092035090-L.jpg" alt="Beautyleg 2019.10.04 No.1826 Anonymity"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2954.html" target="_blank">Beautyleg 2019.10.04 No.1826 Anonymity</a></p></li><li><a href="/taotu/2019/2950.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191005/1-1910050P4310-L.jpg" alt="Beautyleg 2019.09.30 No.1825 Shacy"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2950.html" target="_blank">Beautyleg 2019.09.30 No.1825 Shacy</a></p></li><li><a href="/taotu/2019/2949.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/191005/1-1910050P3400-L.jpg" alt="Beautyleg 2019.09.27 No.1824 Kaylar"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2949.html" target="_blank">Beautyleg 2019.09.27 No.1824 Kaylar</a></p></li><li><a href="/taotu/2019/2948.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/190928/1-1Z92PU9540-L.jpg" alt="Beautyleg 2019.09.25 No.1823 Leonie"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2948.html" target="_blank">Beautyleg 2019.09.25 No.1823 Leonie</a></p></li><li><a href="/taotu/2019/2947.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/190928/1-1Z92PUZ60-L.jpg" alt="Beautyleg 2019.09.23 No.1822 Winnie"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2947.html" target="_blank">Beautyleg 2019.09.23 No.1822 Winnie</a></p></li><li><a href="/taotu/2019/2938.html" target="_blank"><img src="https://img.mm24.cc/uploads/allimg/190922/1-1Z922135T00-L.jpg" alt="Beautyleg 2019.09.20 No.1821 ChiChi"/></a>
+              <p>分类：<a href='/taotu/2019/'>2019</a></p>
+            <p class=p_title><a href="/taotu/2019/2938.html" target="_blank">Beautyleg 2019.09.20 No.1821 ChiChi</a></p></li> 
+
+</ul>
+</div>
+<div class="ad_m"><script src="/ad/list-2.js" type="text/javascript"></script> <div class="bk20"></div>  </div>
+<div class="bk10"></div>
+<center><div id="pages" class="text-c"><a href='1-1.html' class=a1>上一页</a>
+<a href='1-1.html'>1</a>
+<span>2</span>
+<a href='1-3.html'>3</a>
+<a href='1-4.html'>4</a>
+<a href='1-5.html'>5</a>
+<a href='1-6.html'>6</a>
+<a href='1-7.html'>7</a>
+<a href='1-8.html'>8</a>
+<a href='1-9.html'>9</a>
+<a href='1-10.html'>10</a>
+<a href='1-11.html'>11</a>
+<a href='1-3.html'>下一页</a>
+<a href='1-47.html'>末页</a>
+<a class="a1">47页</a>
+</div></center>
+</div>
+<div class="bk10"></div>
+<div class="footer">
+<div class="main">
+<span><a href="http://www.mm24.cc/">爱秀美女</a> 版权声明：所有图片都收集于网络 </span>爱秀美女，追求极致的高清体验！
+<script type="text/javascript" src="https://s5.cnzz.com/z_stat.php?id=1277689883&web_id=1277689883"></script>
+<script type="text/javascript" src="/js/f.js"></script></div>
+
+</div><script>
+(function(){
+    var bp = document.createElement('script');
+    var curProtocol = window.location.protocol.split(':')[0];
+    if (curProtocol === 'https') {
+        bp.src = 'https://zz.bdstatic.com/linksubmit/push.js';        
+    }
+    else {
+        bp.src = 'http://push.zhanzhang.baidu.com/push.js';
+    }
+    var s = document.getElementsByTagName("script")[0];
+    s.parentNode.insertBefore(bp, s);
+})();
+</script>
+
+</body>
+</html>

app/Acfun.php

@@ -0,0 +1,34 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\Acfun
+ *
+ * @property int $id
+ * @property int $media_id 收藏夹识别 id
+ * @property string $title 收藏夹名称
+ * @property int $video_id 视频 id
+ * @property int $is_available 是否有效，0：有效，1：失效
+ * @property int $is_downloaded 是否已下载, 0: 未下载, 1：已下载
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun whereIsAvailable($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun whereIsDownloaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun whereMediaId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun whereTitle($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun whereUpdatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Acfun whereVideoId($value)
+ * @mixin \Eloquent
+ */
+class Acfun extends Model
+{
+    //
+}

app/AcfunUpVideo.php

@@ -0,0 +1,34 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\AcfunUpVideo
+ *
+ * @property int $id
+ * @property int $user_id up的唯一识别 id
+ * @property string $up_name up 名
+ * @property int $video_id 视频 id
+ * @property int $is_available 是否有效，0：有效，1：失效
+ * @property int $is_downloaded 是否已下载, 0: 未下载, 1：已下载
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo whereIsAvailable($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo whereIsDownloaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo whereUpName($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo whereUpdatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo whereUserId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunUpVideo whereVideoId($value)
+ * @mixin \Eloquent
+ */
+class AcfunUpVideo extends Model
+{
+    //
+}

app/AcfunVideo.php

@@ -0,0 +1,41 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\AcfunVideo
+ *
+ * @property int $id
+ * @property int $content_id A站 video 的 id
+ * @property string $title 视频标题
+ * @property int $from_type 来源类型，1：收藏夹，2：up，3：共有
+ * @property string $from_collection_name 来源的收藏夹
+ * @property string $from_up_name 来源的 up 名字
+ * @property int $is_download 是否要下载
+ * @property int $is_downloaded 是否已下载
+ * @property int $total_parts 总的分 P 数
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereContentId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereFromCollectionName($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereFromType($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereFromUpName($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereIsDownload($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereIsDownloaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereTitle($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereTotalParts($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\AcfunVideo whereUpdatedAt($value)
+ * @mixin \Eloquent
+ */
+class AcfunVideo extends Model
+{
+    //
+    protected $guarded = [''];
+}

app/Admin/Controllers/AuthController.php

@@ -0,0 +1,10 @@
+<?php
+
+namespace App\Admin\Controllers;
+
+use Encore\Admin\Controllers\AuthController as BaseAuthController;
+
+class AuthController extends BaseAuthController
+{
+
+}

app/Admin/Controllers/BilibiliVideoController.php

@@ -0,0 +1,91 @@
+<?php
+
+namespace App\Admin\Controllers;
+
+use App\BilibiliVideos;
+use Encore\Admin\Controllers\AdminController;
+use Encore\Admin\Form;
+use Encore\Admin\Grid;
+use Encore\Admin\Show;
+
+class BilibiliVideoController extends AdminController
+{
+    /**
+     * Title for current resource.
+     *
+     * @var string
+     */
+    protected $title = 'App\BilibiliVideos';
+
+    /**
+     * Make a grid builder.
+     *
+     * @return Grid
+     */
+    protected function grid()
+    {
+        $grid = new Grid(new BilibiliVideos());
+        $grid->model()->orderBy('id', 'desc');
+
+        $grid->column('id', __('Id'));
+        $grid->column('aid', __('Aid'));
+        $grid->column('title', __('Title'));
+        $grid->column('from_type', __('From type'));
+        $grid->column('from_collection_name', __('收藏夹'))->filter();
+        $grid->column('from_up_name', __('Up'))->filter();
+        $grid->column('is_download', __('是否要下载'))->editable('select', [1 => '下载', 0 => '不下载'])->filter();
+        $grid->column('is_downloaded', __('是否已下载'))->editable('select', [1 => '已下载', 0 => '未下载'])->filter()->sortable();
+        $grid->column('total_parts', __('分 P 数'));
+        $grid->column('created_at', __('Created at'))->sortable();
+        $grid->column('updated_at', __('Updated at'));
+        $grid->quickSearch('title', 'from_collection_name', 'from_up_name');
+
+        return $grid;
+    }
+
+    /**
+     * Make a show builder.
+     *
+     * @param mixed $id
+     * @return Show
+     */
+    protected function detail($id)
+    {
+        $show = new Show(BilibiliVideos::findOrFail($id));
+
+        $show->field('id', __('Id'));
+        $show->field('aid', __('Aid'));
+        $show->field('title', __('Title'));
+        $show->field('from_type', __('From type'));
+        $show->field('from_collection_name', __('From collection name'));
+        $show->field('from_up_name', __('From up name'));
+        $show->field('is_download', __('Is download'));
+        $show->field('is_downloaded', __('Is downloaded'));
+        $show->field('total_parts', __('Total parts'));
+        $show->field('created_at', __('Created at'));
+        $show->field('updated_at', __('Updated at'));
+
+        return $show;
+    }
+
+    /**
+     * Make a form builder.
+     *
+     * @return Form
+     */
+    protected function form()
+    {
+        $form = new Form(new BilibiliVideos());
+
+        $form->number('aid', __('Aid'));
+        $form->text('title', __('Title'));
+        $form->switch('from_type', __('From type'));
+        $form->text('from_collection_name', __('From collection name'));
+        $form->text('from_up_name', __('From up name'));
+        $form->switch('is_download', __('Is download'))->default(1);
+        $form->switch('is_downloaded', __('Is downloaded'));
+        $form->switch('total_parts', __('Total parts'))->default(1);
+
+        return $form;
+    }
+}

app/Admin/Controllers/ExampleController.php

@@ -0,0 +1,67 @@
+<?php
+
+namespace App\Admin\Controllers;
+
+use Encore\Admin\Controllers\AdminController;
+use Encore\Admin\Form;
+use Encore\Admin\Grid;
+use Encore\Admin\Show;
+
+class ExampleController extends AdminController
+{
+    /**
+     * Title for current resource.
+     *
+     * @var string
+     */
+    protected $title = 'Example controller';
+
+    /**
+     * Make a grid builder.
+     *
+     * @return Grid
+     */
+    protected function grid()
+    {
+        $grid = new Grid(new ExampleModel);
+
+        $grid->column('id', __('ID'))->sortable();
+        $grid->column('created_at', __('Created at'));
+        $grid->column('updated_at', __('Updated at'));
+
+        return $grid;
+    }
+
+    /**
+     * Make a show builder.
+     *
+     * @param mixed   $id
+     * @return Show
+     */
+    protected function detail($id)
+    {
+        $show = new Show(ExampleModel::findOrFail($id));
+
+        $show->field('id', __('ID'));
+        $show->field('created_at', __('Created at'));
+        $show->field('updated_at', __('Updated at'));
+
+        return $show;
+    }
+
+    /**
+     * Make a form builder.
+     *
+     * @return Form
+     */
+    protected function form()
+    {
+        $form = new Form(new ExampleModel);
+
+        $form->display('id', __('ID'));
+        $form->display('created_at', __('Created At'));
+        $form->display('updated_at', __('Updated At'));
+
+        return $form;
+    }
+}

app/Admin/Controllers/HomeController.php

@@ -0,0 +1,34 @@
+<?php
+
+namespace App\Admin\Controllers;
+
+use App\Http\Controllers\Controller;
+use Encore\Admin\Controllers\Dashboard;
+use Encore\Admin\Layout\Column;
+use Encore\Admin\Layout\Content;
+use Encore\Admin\Layout\Row;
+
+class HomeController extends Controller
+{
+    public function index(Content $content)
+    {
+        return $content
+            ->title('Dashboard')
+            ->description('Description...')
+            ->row(Dashboard::title())
+            ->row(function (Row $row) {
+
+                $row->column(4, function (Column $column) {
+                    $column->append(Dashboard::environment());
+                });
+
+                $row->column(4, function (Column $column) {
+                    $column->append(Dashboard::extensions());
+                });
+
+                $row->column(4, function (Column $column) {
+                    $column->append(Dashboard::dependencies());
+                });
+            });
+    }
+}

app/Admin/bootstrap.php

@@ -0,0 +1,21 @@
+<?php
+
+/**
+ * Laravel-admin - admin builder based on Laravel.
+ * @author z-song <https://github.com/z-song>
+ *
+ * Bootstraper for Admin.
+ *
+ * Here you can remove builtin form field:
+ * Encore\Admin\Form::forget(['map', 'editor']);
+ *
+ * Or extend custom form field:
+ * Encore\Admin\Form::extend('php', PHPEditor::class);
+ *
+ * Or require js and css assets:
+ * Admin::css('/packages/prettydocs/css/styles.css');
+ * Admin::js('/packages/prettydocs/js/main.js');
+ *
+ */
+
+Encore\Admin\Form::forget(['map', 'editor']);

app/Admin/routes.php

@@ -0,0 +1,16 @@
+<?php
+
+use Illuminate\Routing\Router;
+
+Admin::routes();
+
+Route::group([
+    'prefix'        => config('admin.route.prefix'),
+    'namespace'     => config('admin.route.namespace'),
+    'middleware'    => config('admin.route.middleware'),
+], function (Router $router) {
+
+    $router->get('/', 'HomeController@index')->name('admin.home');
+    $router->resource('bilibili-videos', BilibiliVideoController::class);
+
+});

app/Afreeca.php

@@ -0,0 +1,24 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\Afreeca
+ *
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Afreeca newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Afreeca newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Afreeca query()
+ * @mixin \Eloquent
+ * @property int $id
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Afreeca whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Afreeca whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Afreeca whereUpdatedAt($value)
+ */
+class Afreeca extends Model
+{
+    //
+}

app/BiCookies.php

@@ -0,0 +1,28 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\BiCookies
+ *
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BiCookies newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BiCookies newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BiCookies query()
+ * @mixin \Eloquent
+ * @property int $id
+ * @property string $cookie
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BiCookies whereCookie($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BiCookies whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BiCookies whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BiCookies whereUpdatedAt($value)
+ */
+class BiCookies extends Model
+{
+    //
+    protected $fillable = ["id", "cookie"];
+
+}

app/BilibiliCollections.php

@@ -0,0 +1,38 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\BilibiliCollections
+ *
+ * @property int $id
+ * @property int $media_id 收藏夹识别 id
+ * @property string $title 收藏夹名称
+ * @property int $video_id 视频 id
+ * @property int $is_available 是否有效，0：有效，1：失效
+ * @property int $is_downloaded 是否已下载, 0: 未下载, 1：已下载
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereIsAvailable($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereIsDownloaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereMediaId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereTitle($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereUpdatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereVideoId($value)
+ * @mixin \Eloquent
+ * @property string|null $videos 视频 av id list
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereVideos($value)
+ * @property string|null $downloaded_videos 已下载的视频
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliCollections whereDownloadedVideos($value)
+ */
+class BilibiliCollections extends Model
+{
+    //
+}

app/BilibiliUpVideos.php

@@ -0,0 +1,38 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\BilibiliUpVideos
+ *
+ * @property int $id
+ * @property int $mid up的唯一识别 id
+ * @property string $up_name up 名
+ * @property int $video_id 视频 id
+ * @property int $is_available 是否有效，0：有效，1：失效
+ * @property int $is_downloaded 是否已下载, 0: 未下载, 1：已下载
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereIsAvailable($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereIsDownloaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereMid($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereUpName($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereUpdatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereVideoId($value)
+ * @mixin \Eloquent
+ * @property string $videos 视频 id
+ * @property string|null $downloaded_videos 已下载的视频 id
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereDownloadedVideos($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliUpVideos whereVideos($value)
+ */
+class BilibiliUpVideos extends Model
+{
+    //
+}

app/BilibiliVideoParts.php

@@ -0,0 +1,40 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\BilibiliVideoParts
+ *
+ * @property int $id
+ * @property int $aid 视频part 关联的视频 id
+ * @property string $part part 名
+ * @property int $page 顺序值
+ * @property int $duration 时长
+ * @property int $is_downloaded 是否已下载
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts whereAid($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts whereDuration($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts whereIsDownloaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts wherePage($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts wherePart($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts whereUpdatedAt($value)
+ * @mixin \Eloquent
+ * @property string $title 标题
+ * @property string $to_download_path 下载路径
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts whereTitle($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideoParts whereToDownloadPath($value)
+ */
+class BilibiliVideoParts extends Model
+{
+    //
+    protected $guarded = [''];
+
+}

app/BilibiliVideoTemp.php

@@ -0,0 +1,10 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class BilibiliVideoTemp extends Model
+{
+    //
+}

app/BilibiliVideos.php

@@ -0,0 +1,43 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\BilibiliVideos
+ *
+ * @property int $id
+ * @property int $aid B站 video 的 id
+ * @property string $title 视频标题
+ * @property int $from_type 来源类型，1：收藏夹，2：up，3：共有
+ * @property string $from_collection_name 来源的收藏夹
+ * @property string $from_up_name 来源的 up 名字
+ * @property int $is_download 是否要下载
+ * @property int $is_downloaded 是否已下载
+ * @property int $total_parts 总的分 P 数
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereAid($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereFromCollectionName($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereFromType($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereFromUpName($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereIsDownload($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereIsDownloaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereTitle($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereTotalParts($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\BilibiliVideos whereUpdatedAt($value)
+ * @mixin \Eloquent
+ */
+class BilibiliVideos extends Model
+{
+    //
+    protected $guarded = [''];
+
+
+}

app/Console/Commands/AcfunScrape.php

@@ -0,0 +1,45 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\AcfunService;
+use Illuminate\Console\Command;
+
+class AcfunScrape extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'acfun:scrape';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        $service = new AcfunService();
+        $service->downloadVideo();
+        //
+    }
+}

app/Console/Commands/AfreecaScrape.php

@@ -0,0 +1,45 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\AfreecaService;
+use Illuminate\Console\Command;
+
+class AfreecaScrape extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'afreeca:list';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        $service = new AfreecaService();
+        $service->getVodList();
+        //
+    }
+}

app/Console/Commands/BiliVideoCode.php

@@ -0,0 +1,64 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\BilibiliService;
+use Illuminate\Console\Command;
+
+class BiliVideoCode extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'bili:nvtuan {type} {code}';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     * @throws \Exception
+     */
+    public function handle()
+    {
+//        dump($this->arguments());exit;
+        //
+        $bilibili = new BilibiliService();
+//        $bilibili->queryLocalUpVideoList();exit;
+//        $bilibili->insertDBTest();exit;
+//        $bilibili->queryPlayList();
+
+        $bilibili->queryUpVideoList(10278125);
+
+        $bilibili->queryDBCollectionList();
+        $bilibili->queryForVideoParts();
+        $bilibili->compareAndDownloadUpVideos();
+        $bilibili->compareAndDownloadCollectionVideos();
+//        $bilibili->queryCollectionList();
+//        $bilibili->compareAndDownloadNewVideos();
+//        $bilibili->queryLocalUpVideoList();
+//        $bilibili->queryForVideoParts();
+//        $bilibili->queryDBCollectionList();
+        $bilibili->checkVideoHasDownload();
+//        echo is_dir("/Volumes/Seagate Backup Plus Drive/Video/bilibili/少女时代");
+
+    }
+}

app/Console/Commands/DailySignCommand.php

@@ -0,0 +1,45 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\DailySignService;
+use Illuminate\Console\Command;
+
+class DailySignCommand extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'daily:hmoe';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        $service = new DailySignService();
+        $service->signClubHmoe();
+        //
+    }
+}

app/Console/Commands/FullSiteCommand.php

@@ -0,0 +1,46 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\FullSiteService;
+use Illuminate\Console\Command;
+
+class FullSiteCommand extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'full:get';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        $service = new FullSiteService();
+//        $service->replaceImagePath();exit;
+        $service->fullSiteDownloadImage();
+        //
+    }
+}

app/Console/Commands/GoogleDriveList.php

@@ -0,0 +1,45 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\GoogleDriveService;
+use Illuminate\Console\Command;
+
+class GoogleDriveList extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'google:test';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        $service = new GoogleDriveService();
+        $service->getFiles();
+        //
+    }
+}

app/Console/Commands/HandBrakeCommand.php

@@ -0,0 +1,45 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\HandBrakeService;
+use Illuminate\Console\Command;
+
+class HandBrakeCommand extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'handle:video';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        //
+        $service = new HandBrakeService();
+        $service->handleVideos();
+    }
+}

app/Console/Commands/InstagramScrape.php

@@ -0,0 +1,48 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\InstagramService;
+use Illuminate\Console\Command;
+
+class InstagramScrape extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'ins:like';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        //
+        $ins = new InstagramService();
+        $ins->scrapeUsers();
+//      $ins->getUserNameById();
+//        $ins->queryFollowUsers();
+//        $ins->commonRequest();
+    }
+}

app/Console/Commands/MMScrape.php

@@ -0,0 +1,46 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\MM24Service;
+use Illuminate\Console\Command;
+
+class MMScrape extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'mm:get';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        //
+        $service = new MM24Service();
+        $service->getAlbum();
+//        $service->getImage();
+    }
+}

app/Console/Commands/NvShenScrape.php

@@ -0,0 +1,49 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\NewNvshenService;
+use App\Services\NvshenService;
+use Illuminate\Console\Command;
+
+class NvShenScrape extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'nvshen:get';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        //
+//        $service = new NvshenService();
+//        $service->scrapeNvshenGirls();
+        $service = new NewNvshenService();
+        $service->scrapeNvshenGirls();
+//        $service->subTest();
+    }
+}

app/Console/Commands/RenameTest.php

@@ -0,0 +1,47 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\RenameService;
+use Illuminate\Console\Command;
+
+class RenameTest extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'rename:test';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        //
+        $rename = new RenameService();
+        $rename->rename("/Users/shixuesen/Documents/tmp/福利姬 软软趴在床单上-铃木美咲(Misaki Suzuki) 合集-TLoB/");
+//        $rename->rename();
+//        $rename->mvFiles("/Users/shixuesen/Documents/tmp/秀人旗下《MFStar模范学院》套图及视频写真-TLoB/视频/");
+    }
+}

app/Console/Commands/TujiguCommand.php

@@ -0,0 +1,52 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\TujiguService;
+use Illuminate\Console\Command;
+
+class TujiguCommand extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'tujigu:s';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        //
+//        $titleStr = "杨晨晨/玛鲁娜/许诺Sabrina/兜豆靓《海边众女神美臀福利》 [爱蜜社IMISS] Vol.150 写真集";
+//        $titleStr = preg_replace("#/#", "-", $titleStr);
+//        echo $titleStr;exit;
+//        $albumUrl = "https://www.tujigu.com/a/8401/";
+//        $albumCode = explode("/", $albumUrl)[4];
+//        echo $albumCode;exit;
+
+        $service = new TujiguService();
+        $service->scrapeTujiguGirls();
+    }
+}

app/Console/Commands/Vita.php

@@ -0,0 +1,45 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\VitabioticsService;
+use Illuminate\Console\Command;
+
+class Vita extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'vita:test';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        //
+        $service = new VitabioticsService();
+        $service->testPromoCode();
+    }
+}

app/Console/Commands/XiuGirlScrape.php

@@ -0,0 +1,48 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Services\NewXiuGirlsService;
+use App\Services\XiuGirlsService;
+use Illuminate\Console\Command;
+
+class XiuGirlScrape extends Command
+{
+    /**
+     * The name and signature of the console command.
+     *
+     * @var string
+     */
+    protected $signature = 'xiu:get';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Command description';
+
+    /**
+     * Create a new command instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return mixed
+     */
+    public function handle()
+    {
+        //
+        $xiu1 = new NewXiuGirlsService();
+        $xiu1->scrapeXiuGirls();exit;
+        $xiu = new XiuGirlsService();
+        $xiu->scrapeXiuGirls();
+    }
+}

app/Console/Kernel.php

@@ -2,9 +2,17 @@
 
 namespace App\Console;
 
+use App\Services\BilibiliService;
+use App\Services\CompressImageService;
+use App\Services\DailySignService;
+use App\Services\NewXiuGirlsService;
+use App\Services\XiuGirlsService;
+use App\Services\VitabioticsService;
+use App\Services\YouKnowService;
 use Illuminate\Console\Scheduling\Schedule;
 use Illuminate\Foundation\Console\Kernel as ConsoleKernel;
 use App\Services\InstagramService;
+use Illuminate\Support\Facades\Log;
 
 
 class Kernel extends ConsoleKernel
@@ -26,13 +34,105 @@ class Kernel extends ConsoleKernel
      */
     protected function schedule(Schedule $schedule)
     {
+        $schedule->call(function () {
+            if ((rand(0, 99) % 2) == 0) {
+                exit();
+            }
+            if(date('H') % 4 != 0) {
+                Log::info("schedule queryUpVideoList skipped at: " .date("Y-m-d H:i:s"));
+                exit;
+            }
+            $bilibili = new BilibiliService();
+            Log::info("schedule queryUpVideoList started at: ". date("Y-m-d H:i:s"));
+            $bilibili->queryUpVideoList();
+        })->hourlyAt(5);
+//    })->yearly();
+        $schedule->call(function () {
+            if ((rand(0, 99) % 2) == 1) {
+                exit();
+            }
+            if(date('H') % 4 != 0) {
+                Log::info("schedule queryDBCollectionList skipped at: " .date("Y-m-d H:i:s"));
+                exit;
+            }
+            $bilibili = new BilibiliService();
+            Log::info("schedule queryDBCollectionList started at: ". date("Y-m-d H:i:s"));
+            $bilibili->queryDBCollectionList();
+        })->hourlyAt(35);
+//    })->yearly();
+        $schedule->call(function () {
+            $bilibili = new BilibiliService();
+            Log::info("schedule compareAndDownloadUpVideos started at: ". date("Y-m-d H:i:s"));
+            $bilibili->compareAndDownloadUpVideos();
+        })->dailyAt('03:00');
+
+        $schedule->call(function () {
+            $bilibili = new BilibiliService();
+            Log::info("schedule compareAndDownloadCollectionVideos started at: ". date("Y-m-d H:i:s"));
+            $bilibili->compareAndDownloadCollectionVideos();
+        })->dailyAt('07:00');
+
+        $schedule->call(function () {
+            $bilibili = new BilibiliService();
+            Log::info("schedule checkVideoHasDownload started at: ". date("Y-m-d H:i:s"));
+            $bilibili->checkVideoHasDownload();
+        })->dailyAt('09:30');
         // $schedule->command('inspire')
         //          ->hourly();
         $schedule->call(function () {
+            echo "======================================================\n";
+            echo "=======================". date("Y-m-d H:i:s") ."=========================\n";
+            echo "======================================================\n";
             $service = new InstagramService();
-            $service->scrapeLikedUsers();
+            //            $service->scrapeLikedUsers();
+            $service->scrapeUsers();
+
+            //            $service = new VitabioticsService();
+            //            $service->testPromoCode();
+
+            //            $service->scrapeUsers();
+            //            $service->scanLocalFiles();
+
+
+            //             $xiuService = new XiuGirlsService();
+            //             $xiuService->scrapeXiuGirls();
+
+            //            $bilibili = new BilibiliService();
+            //            $bilibili->queryUpVideoList();
+
+            //            $bilibili->queryPlayList();
+            //            $bilibili->downloadBSitePlaylist("av75454867 av75207675 av75065073 av74866823 av74764675 av74648540");
+            //            $bilibili->deleteFileNotContainP();
+
+            //            $youService = new YouKnowService();
+            //            $youService->scrape1024();
+
+
+            //            $compressService = new CompressImageService();
+            //            $compressService->compressImage();
             echo "111";
-        })->everyMinute();
+//        })->everyMinute();
+        })->dailyAt("00:10");
+
+        $schedule->call(function () {
+            $service = new InstagramService();
+            $service->scrapeLikedUsers();
+//        })->everyMinute();
+        })->dailyAt('02:00');
+
+        $schedule->call(function () {
+            $xiuService = new NewXiuGirlsService();
+            $xiuService->scrapeXiuGirls();
+//        })->everyMinute();
+        })->dailyAt('05:00');
+        $schedule->call(function () {
+            $dailySignService = new DailySignService();
+            $dailySignService->signClubHmoe();
+        })->dailyAt('04:00');
+
+
+
+//        $schedule->command("vitabiotics")
     }
 
     /**

app/Http/Controllers/AcfunController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\Acfun;
+use Illuminate\Http\Request;
+
+class AcfunController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\Acfun  $acfun
+     * @return \Illuminate\Http\Response
+     */
+    public function show(Acfun $acfun)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\Acfun  $acfun
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(Acfun $acfun)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\Acfun  $acfun
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, Acfun $acfun)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\Acfun  $acfun
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(Acfun $acfun)
+    {
+        //
+    }
+}

app/Http/Controllers/AcfunUpVideoController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\AcfunUpVideo;
+use Illuminate\Http\Request;
+
+class AcfunUpVideoController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\AcfunUpVideo  $acfunUpVideo
+     * @return \Illuminate\Http\Response
+     */
+    public function show(AcfunUpVideo $acfunUpVideo)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\AcfunUpVideo  $acfunUpVideo
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(AcfunUpVideo $acfunUpVideo)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\AcfunUpVideo  $acfunUpVideo
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, AcfunUpVideo $acfunUpVideo)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\AcfunUpVideo  $acfunUpVideo
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(AcfunUpVideo $acfunUpVideo)
+    {
+        //
+    }
+}

app/Http/Controllers/AcfunVideoController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\AcfunVideo;
+use Illuminate\Http\Request;
+
+class AcfunVideoController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\AcfunVideo  $acfunVideo
+     * @return \Illuminate\Http\Response
+     */
+    public function show(AcfunVideo $acfunVideo)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\AcfunVideo  $acfunVideo
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(AcfunVideo $acfunVideo)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\AcfunVideo  $acfunVideo
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, AcfunVideo $acfunVideo)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\AcfunVideo  $acfunVideo
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(AcfunVideo $acfunVideo)
+    {
+        //
+    }
+}

app/Http/Controllers/AfreecaController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\Afreeca;
+use Illuminate\Http\Request;
+
+class AfreecaController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\Afreeca  $afreeca
+     * @return \Illuminate\Http\Response
+     */
+    public function show(Afreeca $afreeca)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\Afreeca  $afreeca
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(Afreeca $afreeca)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\Afreeca  $afreeca
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, Afreeca $afreeca)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\Afreeca  $afreeca
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(Afreeca $afreeca)
+    {
+        //
+    }
+}

app/Http/Controllers/BiCookiesController.php

@@ -0,0 +1,93 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\BiCookies;
+use Illuminate\Http\Request;
+
+class BiCookiesController extends Controller
+{
+
+    public function receiveCookie(Request $request) {
+//        \Log::info("here");
+//        \Log::info(json_encode($request->input()));
+        \Log::info($request->input("cookies"));
+        BiCookies::updateOrCreate(['id' => 1], ["cookie" => base64_encode($request->input("cookies"))]);
+//        echo json_encode($request);
+    }
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\BiCookies  $biCookies
+     * @return \Illuminate\Http\Response
+     */
+    public function show(BiCookies $biCookies)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\BiCookies  $biCookies
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(BiCookies $biCookies)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\BiCookies  $biCookies
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, BiCookies $biCookies)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\BiCookies  $biCookies
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(BiCookies $biCookies)
+    {
+        //
+    }
+}

app/Http/Controllers/BilibiliCollectionsController.php

@@ -0,0 +1,90 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\BilibiliCollections;
+use Illuminate\Http\Request;
+
+class BilibiliCollectionsController extends Controller
+{
+    public function getCookie(Request $request) {
+        \Log::info("here");
+        \Log::info(json_encode($request->input()));
+        echo json_encode($request);
+    }
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\BilibiliCollections  $bilibiliCollections
+     * @return \Illuminate\Http\Response
+     */
+    public function show(BilibiliCollections $bilibiliCollections)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\BilibiliCollections  $bilibiliCollections
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(BilibiliCollections $bilibiliCollections)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\BilibiliCollections  $bilibiliCollections
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, BilibiliCollections $bilibiliCollections)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\BilibiliCollections  $bilibiliCollections
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(BilibiliCollections $bilibiliCollections)
+    {
+        //
+    }
+}

app/Http/Controllers/BilibiliUpVideosController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\BilibiliUpVideos;
+use Illuminate\Http\Request;
+
+class BilibiliUpVideosController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\BilibiliUpVideos  $bilibiliUpVideos
+     * @return \Illuminate\Http\Response
+     */
+    public function show(BilibiliUpVideos $bilibiliUpVideos)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\BilibiliUpVideos  $bilibiliUpVideos
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(BilibiliUpVideos $bilibiliUpVideos)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\BilibiliUpVideos  $bilibiliUpVideos
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, BilibiliUpVideos $bilibiliUpVideos)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\BilibiliUpVideos  $bilibiliUpVideos
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(BilibiliUpVideos $bilibiliUpVideos)
+    {
+        //
+    }
+}

app/Http/Controllers/BilibiliVideoPartsController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\BilibiliVideoParts;
+use Illuminate\Http\Request;
+
+class BilibiliVideoPartsController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\BilibiliVideoParts  $bilibiliVideoParts
+     * @return \Illuminate\Http\Response
+     */
+    public function show(BilibiliVideoParts $bilibiliVideoParts)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\BilibiliVideoParts  $bilibiliVideoParts
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(BilibiliVideoParts $bilibiliVideoParts)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\BilibiliVideoParts  $bilibiliVideoParts
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, BilibiliVideoParts $bilibiliVideoParts)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\BilibiliVideoParts  $bilibiliVideoParts
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(BilibiliVideoParts $bilibiliVideoParts)
+    {
+        //
+    }
+}

app/Http/Controllers/BilibiliVideoTempController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\BilibiliVideoTemp;
+use Illuminate\Http\Request;
+
+class BilibiliVideoTempController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\BilibiliVideoTemp  $bilibiliVideoTemp
+     * @return \Illuminate\Http\Response
+     */
+    public function show(BilibiliVideoTemp $bilibiliVideoTemp)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\BilibiliVideoTemp  $bilibiliVideoTemp
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(BilibiliVideoTemp $bilibiliVideoTemp)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\BilibiliVideoTemp  $bilibiliVideoTemp
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, BilibiliVideoTemp $bilibiliVideoTemp)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\BilibiliVideoTemp  $bilibiliVideoTemp
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(BilibiliVideoTemp $bilibiliVideoTemp)
+    {
+        //
+    }
+}

app/Http/Controllers/BilibiliVideosController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\BilibiliVideos;
+use Illuminate\Http\Request;
+
+class BilibiliVideosController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\BilibiliVideos  $bilibiliVideos
+     * @return \Illuminate\Http\Response
+     */
+    public function show(BilibiliVideos $bilibiliVideos)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\BilibiliVideos  $bilibiliVideos
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(BilibiliVideos $bilibiliVideos)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\BilibiliVideos  $bilibiliVideos
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, BilibiliVideos $bilibiliVideos)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\BilibiliVideos  $bilibiliVideos
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(BilibiliVideos $bilibiliVideos)
+    {
+        //
+    }
+}

app/Http/Controllers/InstagramController.php

@@ -8,6 +8,7 @@ use Illuminate\Http\Request;
 use Microsoft\Graph\Exception\GraphException;
 use Microsoft\Graph\Graph;
 use Microsoft\Graph\Model;
+use Illuminate\Support\Facades\Log;
 
 
 class InstagramController extends Controller
@@ -50,11 +51,27 @@ class InstagramController extends Controller
 //            var_dump($event);exit;
             $subItemUrl =  '/me/drive/items/' . $event->getId(). '/children?'.http_build_query($queryParams);
             $images = $graph->createRequest('GET', $subItemUrl)
-                ->setReturnType(Model\DriveItem::class)
+//                ->setReturnType(Model\DriveItem::class)
                 ->execute();
-            dd($images);
-            exit;
-            var_dump($event);
+//            dd($images->getBody());
+            $body = $images->getBody();
+            $values = $body['value'];
+            foreach ($values as $value) {
+                Log::debug("current user".$event->getName() ." current image " . $value['name']);
+                Instagram::where('image_name', $value['name'])->update(['is_uploaded' => 1]);
+            }
+            while (array_key_exists('@odata.nextLink', $body)) {
+                $nextSubItemUrl = $body['@odata.nextLink'];
+                $response = $graph->createRequest('GET', $nextSubItemUrl)
+                    ->execute();
+                $body = $response->getBody();
+                $values = $body['value'];
+                foreach ($values as $value) {
+                    Log::debug("current user".$event->getName() ." current image " . $value['name']);
+                    Instagram::where('image_name', $value['name'])->update(['is_uploaded' => 1]);
+                }
+            }
+//            var_dump($event);
         }
 
 //        $viewData['events'] = $events;

app/Http/Controllers/InstagramUserController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\InstagramUser;
+use Illuminate\Http\Request;
+
+class InstagramUserController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\InstagramUser  $instagramUser
+     * @return \Illuminate\Http\Response
+     */
+    public function show(InstagramUser $instagramUser)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\InstagramUser  $instagramUser
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(InstagramUser $instagramUser)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\InstagramUser  $instagramUser
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, InstagramUser $instagramUser)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\InstagramUser  $instagramUser
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(InstagramUser $instagramUser)
+    {
+        //
+    }
+}

app/Http/Controllers/WeiboController.php

@@ -0,0 +1,105 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\Services\WeiboService;
+use App\Weibo;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Log;
+
+class WeiboController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    public function list()
+    {
+        // https://m.weibo.cn/api/container/getIndex?containerid=1076035123577126&openApp=0&page='.$i;
+        // Fan_Cam_4K  1076035733650527 page 902
+        // 儒雅随和  1076035123577126 page 139
+        // https://m.weibo.cn/api/container/getIndex?containerid=230259&openApp=0
+
+        $url = array();
+
+        for( $i = 783 ; $i >= 1 ; $i-- )
+            $url[] = 'https://m.weibo.cn/api/container/getIndex?containerid=230259&openApp=0&page='.$i;
+        return response()->json($url);
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+//        die();
+//        Log::info($request->input());
+        $weibo = new WeiboService();
+        $result = $weibo->scrapeWeiboPicAndVideo($request->input("content"));
+        return response()->json($result);
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\Weibo  $weibo
+     * @return \Illuminate\Http\Response
+     */
+    public function show(Weibo $weibo)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\Weibo  $weibo
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(Weibo $weibo)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\Weibo  $weibo
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, Weibo $weibo)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\Weibo  $weibo
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(Weibo $weibo)
+    {
+        //
+    }
+}

app/Http/Controllers/XiuGirlController.php

@@ -0,0 +1,85 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\XiuGirl;
+use Illuminate\Http\Request;
+
+class XiuGirlController extends Controller
+{
+    /**
+     * Display a listing of the resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function index()
+    {
+        //
+    }
+
+    /**
+     * Show the form for creating a new resource.
+     *
+     * @return \Illuminate\Http\Response
+     */
+    public function create()
+    {
+        //
+    }
+
+    /**
+     * Store a newly created resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @return \Illuminate\Http\Response
+     */
+    public function store(Request $request)
+    {
+        //
+    }
+
+    /**
+     * Display the specified resource.
+     *
+     * @param  \App\XiuGirl  $xiuGirl
+     * @return \Illuminate\Http\Response
+     */
+    public function show(XiuGirl $xiuGirl)
+    {
+        //
+    }
+
+    /**
+     * Show the form for editing the specified resource.
+     *
+     * @param  \App\XiuGirl  $xiuGirl
+     * @return \Illuminate\Http\Response
+     */
+    public function edit(XiuGirl $xiuGirl)
+    {
+        //
+    }
+
+    /**
+     * Update the specified resource in storage.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \App\XiuGirl  $xiuGirl
+     * @return \Illuminate\Http\Response
+     */
+    public function update(Request $request, XiuGirl $xiuGirl)
+    {
+        //
+    }
+
+    /**
+     * Remove the specified resource from storage.
+     *
+     * @param  \App\XiuGirl  $xiuGirl
+     * @return \Illuminate\Http\Response
+     */
+    public function destroy(XiuGirl $xiuGirl)
+    {
+        //
+    }
+}

app/Http/Middleware/VerifyCsrfToken.php

@@ -20,5 +20,6 @@ class VerifyCsrfToken extends Middleware
      */
     protected $except = [
         //
+        'api/*'
     ];
 }

app/Instagram.php

@@ -11,11 +11,27 @@ use Illuminate\Database\Eloquent\Model;
  * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram newQuery()
  * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram query()
  * @mixin \Eloquent
+ * @property int $id
+ * @property string $username
+ * @property string $image_url
+ * @property int $has_downloaded
+ * @property int $is_uploaded
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @property string $image_name
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram whereHasDownloaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram whereImageName($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram whereImageUrl($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram whereIsUploaded($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram whereUpdatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Instagram whereUsername($value)
  */
 class Instagram extends Model
 {
     //
     protected $table = "instagram";
 
-    protected $fillable = ["image_name", "username", "image_url"];
+    protected $fillable = ["image_name", "username", "image_url", 'is_uploaded'];
 }

app/InstagramUser.php

@@ -0,0 +1,30 @@
+<?php
+
+namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+/**
+ * App\InstagramUser
+ *
+ * @property int $id
+ * @property string $user_name
+ * @property string $user_id
+ * @property string|null $deleted_at
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser whereDeletedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser whereUpdatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser whereUserId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\InstagramUser whereUserName($value)
+ * @mixin \Eloquent
+ */
+class InstagramUser extends Model
+{
+    //
+}

app/Repositories/CosInsRepository.php

@@ -0,0 +1,11 @@
+<?php
+
+
+namespace App\Repositories;
+
+
+
+class CosInsRepository
+{
+
+}

app/Services/AcfunService.php

@@ -0,0 +1,147 @@
+<?php
+
+
+namespace App\Services;
+
+
+use App\AcfunVideo;
+use Illuminate\Support\Arr;
+use Log;
+
+class AcfunService
+{
+
+    private $CollectionUrl = "https://www.acfun.cn/rest/pc-direct/favorite/dougaList";
+
+    public function queryCollectionVideos()
+    {
+        for ($i = 1; $i < 100; $i++) {
+            sleep(5);
+            $param = "perpage=100&page=" . $i;
+            $result = $this->request($this->CollectionUrl, $param);
+            $parsedResult = json_decode($result, true);
+            if(count(Arr::get($parsedResult, "favoriteList", [])) > 0) {
+                foreach ($parsedResult["favoriteList"] as $item) {
+                    AcfunVideo::firstOrCreate(["content_id" => $item["contentId"]],
+                        [
+                            "title" => $item["contentTitle"],
+                            "from_type" => 1,
+                            "from_collection_name" => "默认",
+                            "from_up_name" => $item["userName"],
+                            "from_up_user_id" => $item["userId"]
+                        ]);
+                }
+
+            }
+        }
+
+    }
+
+    public function request($url, $param)
+    {
+
+
+        $curl = curl_init();
+
+        curl_setopt_array($curl, array(
+            CURLOPT_URL => $url,
+            CURLOPT_RETURNTRANSFER => true,
+            CURLOPT_ENCODING => "",
+            CURLOPT_MAXREDIRS => 10,
+            CURLOPT_TIMEOUT => 0,
+            CURLOPT_FOLLOWLOCATION => true,
+            CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+            CURLOPT_CUSTOMREQUEST => "POST",
+            CURLOPT_POSTFIELDS =>$param,
+            CURLOPT_HTTPHEADER => array(
+                "authority: www.acfun.cn",
+                "pragma: no-cache",
+                "cache-control: no-cache",
+                "accept: */*",
+                "x-requested-with: XMLHttpRequest",
+                "user-agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/83.0.4103.106 Safari/537.36",
+                "content-type: application/x-www-form-urlencoded; charset=UTF-8",
+                "origin: https://www.acfun.cn",
+                "sec-fetch-site: same-origin",
+                "sec-fetch-mode: cors",
+                "sec-fetch-dest: empty",
+                "referer: https://www.acfun.cn/member/",
+                "accept-language: zh-CN,zh;q=0.9,en-US;q=0.8,en;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+                "cookie: _did=web_32586178239268B; sign_remind=1; ac__avi=1010934062045114530882ab2cd25b90ef370ea22b151084981cf6c2c6febafe3a364146315ef65213; uuid=d7fdb48c886459236faa794ffafbfbb0; analytics=GA1.2.626694313.1592365512; lsv_js_player_v2_main=62b719; csrfToken=TnNz3lG1IfA-93kw4M-Px06m; session_id=63965769975BFD30; webp_supported=%7B%22lossy%22%3Atrue%2C%22lossless%22%3Atrue%2C%22alpha%22%3Atrue%2C%22animation%22%3Atrue%7D; Hm_lvt_2af69bc2b378fb58ae04ed2a04257ed1=1592481541,1592489023,1592797550,1592976124; lsv_js_player_v1_main=f2c6e6; stochastic=NWFlaDB1ZjlmNXE%3D; acPasstoken=ChVpbmZyYS5hY2Z1bi5wYXNzdG9rZW4ScJrFeEdlHcrvoHjYpzy_V7pAPxxMhNmo45RlMccpB84XwmIx9rJocLwXSPnJu4btgtqVGa04P9AIMBNdQknDd4QRTbjBp5aoQgis-Q88BjMvqVTGHAjG04W7zjswa0ZC5k5sdJCeTsLJKEiEsE8EY90aEhwsbiM70HUviQANoYC6Iptv6yIg0X6u8ikzzwuDe1VMKWNNYXWwFR81YKYQNq9P4gsk5oMoBTAB; auth_key=572984; ac_username=Nicksxs; acPostHint=1cc641584039a19bc0941d00e8eff73bd4b0; ac_userimg=https%3A%2F%2Fimgs.aixifan.com%2Fstyle%2Fimage%2F201907%2FuQ5Vc06d3HSVTjY3VZocT81X40FByVpw.jpg; clientlanguage=zh_CN; safety_id=AAG%2B9AbVZS6fTHVxwLtsI9Jl; notice_status=1; online_status=0; userGroupLevel=1; checkMobile=1; checkEmail=1; cur_req_id=1296724223CA632E_self_0fb782b0474cbe335574779cf53ed145; cur_group_id=1296724223CA632E_self_0fb782b0474cbe335574779cf53ed145_0; Hm_lpvt_2af69bc2b378fb58ae04ed2a04257ed1=1592976174"
+            ),
+        ));
+
+        $response = curl_exec($curl);
+
+        curl_close($curl);
+        return $response;
+
+    }
+
+    public function onlyRequest()
+    {
+
+
+        $curl = curl_init();
+
+        curl_setopt_array($curl, array(
+            CURLOPT_URL => "https://www.acfun.cn/rest/pc-direct/favorite/dougaList",
+            CURLOPT_RETURNTRANSFER => true,
+            CURLOPT_ENCODING => "",
+            CURLOPT_MAXREDIRS => 10,
+            CURLOPT_TIMEOUT => 0,
+            CURLOPT_FOLLOWLOCATION => true,
+            CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+            CURLOPT_CUSTOMREQUEST => "POST",
+            CURLOPT_POSTFIELDS => "perpage=100&page=1",
+            CURLOPT_HTTPHEADER => array(
+                "authority: www.acfun.cn",
+                "pragma: no-cache",
+                "cache-control: no-cache",
+                "accept: */*",
+                "x-requested-with: XMLHttpRequest",
+                "user-agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/83.0.4103.106 Safari/537.36",
+                "content-type: application/x-www-form-urlencoded; charset=UTF-8",
+                "origin: https://www.acfun.cn",
+                "sec-fetch-site: same-origin",
+                "sec-fetch-mode: cors",
+                "sec-fetch-dest: empty",
+                "referer: https://www.acfun.cn/member/",
+                "accept-language: zh-CN,zh;q=0.9,en-US;q=0.8,en;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+                "cookie: _did=web_32586178239268B; sign_remind=1; ac__avi=1010934062045114530882ab2cd25b90ef370ea22b151084981cf6c2c6febafe3a364146315ef65213; uuid=d7fdb48c886459236faa794ffafbfbb0; analytics=GA1.2.626694313.1592365512; lsv_js_player_v2_main=62b719; csrfToken=TnNz3lG1IfA-93kw4M-Px06m; session_id=63965769975BFD30; webp_supported=%7B%22lossy%22%3Atrue%2C%22lossless%22%3Atrue%2C%22alpha%22%3Atrue%2C%22animation%22%3Atrue%7D; Hm_lvt_2af69bc2b378fb58ae04ed2a04257ed1=1592481541,1592489023,1592797550,1592976124; lsv_js_player_v1_main=f2c6e6; stochastic=NWFlaDB1ZjlmNXE%3D; acPasstoken=ChVpbmZyYS5hY2Z1bi5wYXNzdG9rZW4ScJrFeEdlHcrvoHjYpzy_V7pAPxxMhNmo45RlMccpB84XwmIx9rJocLwXSPnJu4btgtqVGa04P9AIMBNdQknDd4QRTbjBp5aoQgis-Q88BjMvqVTGHAjG04W7zjswa0ZC5k5sdJCeTsLJKEiEsE8EY90aEhwsbiM70HUviQANoYC6Iptv6yIg0X6u8ikzzwuDe1VMKWNNYXWwFR81YKYQNq9P4gsk5oMoBTAB; auth_key=572984; ac_username=Nicksxs; acPostHint=1cc641584039a19bc0941d00e8eff73bd4b0; ac_userimg=https%3A%2F%2Fimgs.aixifan.com%2Fstyle%2Fimage%2F201907%2FuQ5Vc06d3HSVTjY3VZocT81X40FByVpw.jpg; clientlanguage=zh_CN; safety_id=AAG%2B9AbVZS6fTHVxwLtsI9Jl; notice_status=1; online_status=0; userGroupLevel=1; checkMobile=1; checkEmail=1; cur_req_id=1296724223CA632E_self_0fb782b0474cbe335574779cf53ed145; cur_group_id=1296724223CA632E_self_0fb782b0474cbe335574779cf53ed145_0; Hm_lpvt_2af69bc2b378fb58ae04ed2a04257ed1=1592976174",
+//                "Content-Type: text/plain"
+            ),
+        ));
+
+        $response = curl_exec($curl);
+
+        curl_close($curl);
+        echo $response;
+
+    }
+
+    public function downloadVideo()
+    {
+        $innerDir = "/Volumes/intel660p/video/mv/acfun";
+        $list = AcfunVideo::all();
+        $files = scandir($innerDir);
+
+//        dump($files);
+        foreach ($list as $item) {
+            if ($item["is_downloaded"] == 1) {
+                continue;
+            }
+            if (in_array($item['title'] . " (" . $item["from_up_name"] .  ").mp4", $files)) {
+                Log::info("file " . $item["title"] . ".mp4" . " exists continue");
+                continue;
+            }
+            Log::info($item['title'] . " (" . $item["from_up_name"] .  ").mp4" . " does not exists to download");
+//            exit;
+            $downloadResult = shell_exec('cd "' .$innerDir .'" && you-get  https://www.acfun.cn/v/ac' . $item["content_id"]);
+            Log::info($downloadResult);
+            $item["is_downloaded"] = 1;
+            $item->save();
+        }
+    }
+
+}

app/Services/AfreecaService.php

@@ -0,0 +1,125 @@
+<?php
+//require __DIR__ . '/vendor/autoload.php';
+
+
+
+
+namespace App\Services;
+
+use Illuminate\Support\Facades\Log;
+use YoutubeDl\YoutubeDl;
+use YoutubeDl\Exception\CopyrightException;
+use YoutubeDl\Exception\NotFoundException;
+use YoutubeDl\Exception\PrivateVideoException;
+
+
+class AfreecaService
+{
+
+    public function getVodList()
+    {
+        $base_url = "http://bjapi.afreecatv.com/api/minhee3769/vods?field=contents&page=";
+        for ($i = 1; $i < 13; $i++) {
+            $curl = curl_init();
+
+            curl_setopt_array($curl, array(
+                CURLOPT_URL => $base_url . $i,
+                CURLOPT_RETURNTRANSFER => true,
+                CURLOPT_ENCODING => "",
+                CURLOPT_MAXREDIRS => 10,
+                CURLOPT_TIMEOUT => 30,
+                CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+                CURLOPT_CUSTOMREQUEST => "GET",
+                CURLOPT_HTTPHEADER => array(
+                    "Accept: text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,image/apng,*/*;q=0.8,application/signed-exchange;v=b3",
+                    "Accept-Encoding: gzip, deflate, br",
+                    "Accept-Language: zh-CN,zh;q=0.9,en-US;q=0.8,en;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+                    "Cache-Control: no-cache",
+                    "Connection: keep-alive",
+                    "Referer: https://www.bilibili.com",
+                    "Pragma: no-cache",
+                    "Sec-Fetch-Mode: navigate",
+                    "Sec-Fetch-Site: none",
+                    "Sec-Fetch-User: ?1",
+                    "Upgrade-Insecure-Requests: 1",
+                    "User-Agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/78.0.3904.97 Safari/537.36",
+                    "cache-control: no-cache"
+                ),
+            ));
+
+            $response = curl_exec($curl);
+            $err = curl_error($curl);
+
+            curl_close($curl);
+
+            if ($err) {
+                echo "cURL Error #:" . $err;
+            } else {
+                $content = json_decode($response, true);
+                foreach ($content["data"] as $item) {
+                    echo "http://vod.afreecatv.com/PLAYER/STATION/" . $item["title_no"] . "\n";
+                    self::downloadVideo("http://vod.afreecatv.com/PLAYER/STATION/" . $item["title_no"] );
+                }
+            }
+//            $listContent = file_get_contents($base_url . $i);
+//            $content = json_decode($listContent, true);
+//            $data = $content["data"];
+//            foreach ($data as $item) {
+//                echo "http://vod.afreecatv.com/PLAYER/STATION/" . $item["45082989"] . "\n";
+//            }
+
+        }
+    }
+
+    public function downloadVideo($url)
+    {
+        $dl = new YoutubeDl([
+            'continue' => true, // force resume of partially downloaded files. By default, youtube-dl will resume downloads if possible.
+//            'format' => 'bestvideo',
+        ]);
+        // For more options go to https://github.com/rg3/youtube-dl#user-content-options
+
+        $dl->setDownloadPath('/Volumes/intel660p/video/live/afreeca');
+        // Enable debugging
+        $dl->debug(function ($type, $buffer) {
+            if (\Symfony\Component\Process\Process::ERR === $type) {
+                echo 'ERR > ' . $buffer;
+            } else {
+                echo 'OUT > ' . $buffer;
+            }
+        });
+        $dl->onProgress(function ($progress) {
+            $percentage = $progress['percentage'];
+            $size = $progress['size'];
+            $speed = $progress['speed'] ?? null;
+            $eta = $progress['eta'] ?? null;
+
+            echo "Percentage: $percentage; Size: $size";
+            if ($speed) {
+                echo "; Speed: $speed";
+            }
+            if ($eta) {
+                echo "; ETA: $eta";
+            }
+            // Will print: Percentage: 21.3%; Size: 4.69MiB; Speed: 4.47MiB/s; ETA: 00:01
+        });
+        try {
+            $video = $dl->download($url);
+            echo $video->getTitle(); // Will return Phonebloks
+            // $video->getFile(); // \SplFileInfo instance of downloaded file
+        } catch (NotFoundException $e) {
+            // Video not found
+            Log::error($e->getTraceAsString());
+        } catch (PrivateVideoException $e) {
+            // Video is private
+            Log::error($e->getTraceAsString());
+        } catch (CopyrightException $e) {
+            // The YouTube account associated with this video has been terminated due to multiple third-party notifications of copyright infringement
+        } catch (\Exception $e) {
+            // Failed to download
+            Log::error($e->getTraceAsString());
+        }
+
+    }
+
+}

app/Services/BilibiliService.php

@@ -0,0 +1,841 @@
+<?php
+
+
+namespace App\Services;
+
+use App\BilibiliCollections;
+use App\BilibiliUpVideos;
+use App\BilibiliVideoParts;
+use App\BilibiliVideos;
+use App\BilibiliVideoTemp;
+use GuzzleHttp\Client;
+use Illuminate\Support\Arr;
+use Illuminate\Support\Facades\DB;
+use Illuminate\Support\Facades\Log;
+
+class BilibiliService
+{
+
+    private $collectionNumberListUrl = "https://api.bilibili.com/medialist/gateway/base/created?ps=100&up_mid=279025&is_space=0&jsonp=jsonp";
+
+    private $collectionListUrl = "https://api.bilibili.com/medialist/gateway/base/spaceDetail?ps=20&keyword=&order=mtime&type=0&tid=0&jsonp=jsonp";
+
+    private $videoPartsUrl = "https://api.bilibili.com/x/player/pagelist?jsonp=jsonp&aid=";
+
+    private $invalidTitle = "已失效视频";
+
+    private $baseDir = "/Volumes/intel660p/video/mv/";
+
+    public function queryPlayList()
+    {
+        $pageNo = 1;
+        $url = "https://space.bilibili.com/ajax/member/getSubmitVideos?mid=391073761&pagesize=30&tid=0&keyword=&order=pubdate&page=";
+        for ($i = 1; $i < 30; $i++) {
+            # code...
+            $result = json_decode(file_get_contents($url . $i), true);
+            foreach ($result['data']['vlist'] as $item) {
+                echo "av" . $item['aid'] . " ";
+            }
+            //            echo $result['data']['vlist'][0]['aid'] . "\t";
+            //            $pageNo++;
+        }
+    }
+
+    /**
+     * 获取各个 up 主的视频 id
+     * @param int $mediaId
+     * @throws \Exception
+     */
+    public function queryUpVideoList($mediaId = 320491072)
+    {
+        Log::info("schedule queryUpVideoList inner started at: " . date("Y-m-d H:i:s"));
+
+
+        // 475250 kyokyo
+        // 3489535 熊小颖
+        // 320491072 绯绯
+        // 10139490 短短
+        // 116683 咬人猫
+        // 16539048 小仙若
+        // 10278125 香草猫饼
+        // 391073761 女团直拍
+        // 267781236 韩国女团饭拍直拍
+        // 23400436 小雪_juvia
+        $list = BilibiliUpVideos::all();
+        foreach ($list as $item) {
+            Log::info("schedule queryUpVideoList current up is {$item['up_name']}, started at: " . date("Y-m-d H:i:s"));
+//            $files = scandir($this->baseDir . "bilibili/" . $item['up_name']);
+
+            $mediaId = $item['mid'];
+            $videos = [];
+            $pageNo = 1;
+            $url = "https://api.bilibili.com/x/space/arc/search?mid={$mediaId}&ps=30&tid=0&keyword=&order=pubdate&jsonp=jsonp&pn=";
+
+            //        https://space.bilibili.com/475250/video
+            for ($i = 1; $i < 10; $i++) {
+                $curl = curl_init();
+
+                curl_setopt_array($curl, array(
+                    CURLOPT_URL => "https://api.bilibili.com/x/space/arc/search?mid={$mediaId}&ps=30&tid=0&keyword=&order=pubdate&jsonp=jsonp&pn={$i}",
+                    CURLOPT_RETURNTRANSFER => true,
+                    CURLOPT_ENCODING => "",
+                    CURLOPT_MAXREDIRS => 10,
+                    CURLOPT_TIMEOUT => 30,
+                    CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+                    CURLOPT_CUSTOMREQUEST => "GET",
+                    CURLOPT_HTTPHEADER => array(
+                        "Accept: text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,image/apng,*/*;q=0.8,application/signed-exchange;v=b3",
+                        "Accept-Encoding: gzip, deflate, br",
+                        "Accept-Language: zh-CN,zh;q=0.9,en-US;q=0.8,en;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+                        "Cache-Control: no-cache",
+                        "Connection: keep-alive",
+                        "Referer: https://www.bilibili.com",
+                        "Pragma: no-cache",
+                        "Sec-Fetch-Mode: navigate",
+                        "Sec-Fetch-Site: none",
+                        "Sec-Fetch-User: ?1",
+                        "Upgrade-Insecure-Requests: 1",
+                        "User-Agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/78.0.3904.97 Safari/537.36",
+                        "cache-control: no-cache"
+                    ),
+                ));
+
+                $response = curl_exec($curl);
+                $err = curl_error($curl);
+
+                curl_close($curl);
+
+                if ($err) {
+                    echo "cURL Error #:" . $err;
+                } else {
+                    //                echo $response;
+                    $result = json_decode($response, true);
+                    $result = Arr::get($result["data"]["list"], "vlist", []);
+                    if (count($result) > 0) {
+                        foreach ($result as $vItem) {
+                            $bVideo = BilibiliVideos::firstOrCreate(["aid" => $vItem["aid"]],
+                                [
+                                    "title" => $vItem["title"],
+                                    "from_type" => 2,
+                                    "from_up_name" => $item["up_name"]
+                                ]);
+                            if ($bVideo->from_type != 2) {
+                                $bVideo->from_type = 3;
+                            }
+                            $bVideo->from_up_name = $item["up_name"];
+                            $bVideo->save();
+                            $videos[] = $vItem["aid"];
+                        }
+                    } else {
+                        break;
+                    }
+                }
+                usleep(random_int(1000, 10000) * 1000);
+            }
+            $item['videos'] = json_encode($videos);
+            //            $item['downloaded_videos'] = json_encode([]);
+            $item->save();
+        }
+
+
+    }
+
+    /**
+     * 手动执行查询
+     * @param int $mediaId
+     * @throws \Exception
+     */
+    public function queryLocalUpVideoList($mediaId = 320491072)
+    {
+        Log::info("schedule queryUpVideoList inner started at: " . date("Y-m-d H:i:s"));
+
+
+        // 475250 kyokyo
+        // 3489535 熊小颖
+        // 320491072 绯绯
+        // 10139490 短短
+        // 116683 咬人猫
+        // 16539048 小仙若
+        // 10278125 香草猫饼
+        // 391073761 女团直拍
+//        $list = BilibiliUpVideos::all();
+        $list = [];
+        $up = ["mid" => 391073761, "up_name" => "女团直拍"];
+        $up = ["mid" => 254624554, "up_name" => "女团能量站"];
+        $list[] = $up;
+        foreach ($list as $item) {
+            Log::info("schedule queryUpVideoList current up is {$item['up_name']}, started at: " . date("Y-m-d H:i:s"));
+            $files = scandir($this->baseDir . "bilibili/" . $item['up_name']);
+
+            $mediaId = $item['mid'];
+            $videos = [];
+            $pageNo = 1;
+            $url = "https://api.bilibili.com/x/space/arc/search?mid={$mediaId}&ps=30&tid=0&keyword=&order=pubdate&jsonp=jsonp&pn=";
+
+            //        https://space.bilibili.com/475250/video
+            for ($i = 1; $i < 50; $i++) {
+                $curl = curl_init();
+
+                curl_setopt_array($curl, array(
+                    CURLOPT_URL => "https://api.bilibili.com/x/space/arc/search?mid={$mediaId}&ps=30&tid=0&keyword=&order=pubdate&jsonp=jsonp&pn={$i}",
+                    CURLOPT_RETURNTRANSFER => true,
+                    CURLOPT_ENCODING => "",
+                    CURLOPT_MAXREDIRS => 10,
+                    CURLOPT_TIMEOUT => 30,
+                    CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+                    CURLOPT_CUSTOMREQUEST => "GET",
+                    CURLOPT_HTTPHEADER => array(
+                        "Accept: text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,image/apng,*/*;q=0.8,application/signed-exchange;v=b3",
+                        "Accept-Encoding: gzip, deflate, br",
+                        "Accept-Language: zh-CN,zh;q=0.9,en-US;q=0.8,en;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+                        "Cache-Control: no-cache",
+                        "Connection: keep-alive",
+                        "Referer: https://www.bilibili.com",
+                        "Pragma: no-cache",
+                        "Sec-Fetch-Mode: navigate",
+                        "Sec-Fetch-Site: none",
+                        "Sec-Fetch-User: ?1",
+                        "Upgrade-Insecure-Requests: 1",
+                        "User-Agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/78.0.3904.97 Safari/537.36",
+                        "cache-control: no-cache"
+                    ),
+                ));
+
+                $response = curl_exec($curl);
+                $err = curl_error($curl);
+
+                curl_close($curl);
+
+                if ($err) {
+                    echo "cURL Error #:" . $err;
+                } else {
+                    //                echo $response;
+                    $result = json_decode($response, true);
+                    $result = Arr::get($result["data"]["list"], "vlist", []);
+                    if (count($result) > 0) {
+                        foreach ($result as $vItem) {
+                            echo "av" . $vItem["aid"] . " ";
+//                            $videos[] = $vItem["aid"];
+                        }
+                    } else {
+                        break;
+                    }
+                }
+                usleep(random_int(1000, 10000) * 1000);
+            }
+//            $item['videos'] = json_encode($videos);
+            //            $item['downloaded_videos'] = json_encode([]);
+//            $item->save();
+        }
+
+
+    }
+
+    public function compareAndDownloadUpVideos()
+    {
+        $list = BilibiliUpVideos::all();
+        foreach ($list as $item) {
+            if ($item["is_downloaded"] == 1) {
+                continue;
+            }
+            Log::info("schedule compareAndDownloadUpVideos current up is {$item['up_name']}, started at: " . date("Y-m-d H:i:s"));
+            $unDownloaded = array_diff(json_decode($item["videos"]), json_decode($item["downloaded_videos"]));
+            $videoList = [];
+            foreach ($unDownloaded as $value) {
+                $vItems = BilibiliVideos::where('aid', $value)->get();
+                if (count($vItems) > 0) {
+                    foreach ($vItems as $vItem) {
+                        if ($vItem["is_download"] == 1 && $vItem["is_downloaded"] == 0) {
+//                            $videoList[] = "av" . $value;
+                            $videoList = [];
+                            $videoList[$value] = $vItem->total_parts;
+                            $this->partDownloadBSitePlaylist($videoList, $this->baseDir . "bilibili/", $item['up_name']);
+                        }
+                    }
+                }
+//                $videoList[] = "av" . $value;
+            }
+//            $this->downloadBSitePlaylist($videoList, $this->baseDir . "bilibili/", $item['up_name']);
+        }
+    }
+
+    public function compareAndDownloadCollectionVideos()
+    {
+        $list = BilibiliCollections::all();
+        foreach ($list as $item) {
+            echo "current title is " . $item["title"] . "\n";
+            if ($item["is_downloaded"] == 1) {
+                continue;
+            }
+            Log::info("schedule compareAndDownloadCollectionVideos current collection is {$item['title']}, started at: " . date("Y-m-d H:i:s"));
+            $newVideos = json_decode($item["videos"], true);
+            $oldVideos = json_decode($item["downloaded_videos"], true);
+            $unDownloaded = array_diff($newVideos, $oldVideos);
+            if (count($unDownloaded) == 0) {
+                continue;
+            }
+            dump($unDownloaded);
+            $videoList = [];
+            foreach ($unDownloaded as $value) {
+                $vItems = BilibiliVideos::where('aid', $value)->get();
+                if (count($vItems) > 0) {
+                    foreach ($vItems as $vItem) {
+                        if ($vItem["is_download"] == 1 && $vItem["is_downloaded"] == 0) {
+                            $videoList[] = "av" . $value;
+                            $videoMap = [];
+                            $videoMap[$value] = $vItem->total_parts;
+                            if ($item['title'] == "默认收藏夹") {
+                                dump("xxxxxxxxxxxx----------------");
+                                $this->partDownloadBSitePlaylist($videoMap, $this->baseDir, "bilibili");
+                            } else if ($item['title'] == '少女时代') {
+                                $this->partDownloadBSitePlaylist($videoMap, "/Volumes/WD/tmp/bilibili/少女时代", "");
+                            } else {
+                                $this->partDownloadBSitePlaylist($videoMap, $this->baseDir . "bilibili/", $item['title']);
+                            }
+                        }
+                    }
+                }
+            }
+//            if ($item['title'] == "默认收藏夹") {
+//                dump("xxxxxxxxxxxx----------------");
+//                $this->downloadBSitePlaylist($videoList, $this->baseDir, "bilibili");
+//            } else if ($item['title'] == '少女时代') {
+//               $this->downloadBSitePlaylist($videoList, "/Volumes/Seagate Backup Plus Drive/Video/bilibili/少女时代", "");
+//            } else {
+//                $this->downloadBSitePlaylist($videoList, $this->baseDir . "bilibili/", $item['title']);
+//            }
+        }
+    }
+
+    public function queryFavList()
+    {
+        // aoa 50076725
+        // default 50069625
+        // 美腿 156009025
+        // 允儿 154442125
+        // 少女时代 153944525
+        $invalidTitle = "已失效视频";
+        $pageNo = 1;
+
+
+        for ($i = 1; $i < 65; $i++) {
+            $curl = curl_init();
+            $url = "https://api.bilibili.com/medialist/gateway/base/spaceDetail?media_id=154442125&pn={$i}&ps=20&keyword=&order=mtime&type=0&tid=0&jsonp=jsonp";
+            curl_setopt_array($curl, array(
+                CURLOPT_URL => $url,
+                CURLOPT_RETURNTRANSFER => true,
+                CURLOPT_ENCODING => "",
+                CURLOPT_MAXREDIRS => 10,
+                CURLOPT_TIMEOUT => 30,
+                CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+                CURLOPT_CUSTOMREQUEST => "GET",
+                CURLOPT_HTTPHEADER => array(
+                    "Accept: application/json, text/plain, */*",
+                    "Accept-Encoding: gzip, deflate, br",
+                    "Accept-Language: en-US,en;q=0.9,zh-CN;q=0.8,zh;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+                    "Cache-Control: no-cache",
+                    "Connection: keep-alive",
+                    //                    "Cookie: buvid3=5566647C-DDE5-4AFF-8711-89C9DB2B7061110244infoc; LIVE_BUVID=AUTO2315591376644842; sid=kbyrjw72; stardustvideo=1; CURRENT_FNVAL=16; rpdid=|(J~|JluJmmk0J\'ullmuJ~~kJ; CURRENT_QUALITY=80; UM_distinctid=16b11bb4099eb-033fd8b69a435d-37647e03-13c680-16b11bb40bf97; fts=1562149769; im_notify_type_279025=0; _uuid=69A60E94-E8FE-54B8-DCCD-0F519F0DEF7480343infoc; DedeUserID=279025; DedeUserID__ckMd5=9a79e15294e6b8bb; SESSDATA=b114a39d%2C1573361994%2C2ed0a2a1; bili_jct=b35f8e9780e4a80dd07f316f781f179b; bp_t_offset_279025=315386152995357818",
+                    "Cookie: SESSDATA=64a15917%2C1578628130%2Ceb05cdc1",
+                    "Host: api.bilibili.com",
+                    "Origin: https://space.bilibili.com",
+                    "Postman-Token: c7f849ec-aaf9-4c71-851d-4ca061e725d0,f8f582bc-4872-4aa7-b209-b926364d4d1a",
+                    "Referer: https://space.bilibili.com/279025/favlist",
+                    "Sec-Fetch-Mode: cors",
+                    "Sec-Fetch-Site: same-site",
+                    "User-Agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/78.0.3904.70 Safari/537.36",
+                    "cache-control: no-cache"
+                ),
+            ));
+
+            $response = curl_exec($curl);
+            $err = curl_error($curl);
+
+            curl_close($curl);
+
+            if ($err) {
+                echo "cURL Error #:" . $err;
+            } else {
+                $responseArr = json_decode($response, true);
+                if ($responseArr['code'] == 0) {
+                    $data = $responseArr['data'];
+                    $medias = $data['medias'];
+                    if (count($medias) > 0) {
+                        foreach ($medias as $item) {
+                            if ($item['title'] != $invalidTitle) {
+                                echo "av" . $item['id'] . " ";
+                            }
+                        }
+                    }
+                }
+            }
+            usleep(random_int(1000, 10000) * 1000);
+        }
+
+
+    }
+
+    public function getAoaFavList($id = 50076725)
+    {
+        $invalidTitle = "已失效视频";
+        $pageNo = 1;
+
+
+        for ($i = 1; $i < 65; $i++) {
+            $curl = curl_init();
+            $url = "https://api.bilibili.com/medialist/gateway/base/spaceDetail?media_id=50076725&pn={$i}&ps=20&keyword=&order=mtime&type=0&tid=0&jsonp=jsonp";
+            curl_setopt_array($curl, array(
+                CURLOPT_URL => $url,
+                CURLOPT_RETURNTRANSFER => true,
+                CURLOPT_ENCODING => "",
+                CURLOPT_MAXREDIRS => 10,
+                CURLOPT_TIMEOUT => 30,
+                CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+                CURLOPT_CUSTOMREQUEST => "GET",
+                CURLOPT_HTTPHEADER => array(
+                    "Accept: application/json, text/plain, */*",
+                    "Accept-Encoding: gzip, deflate, br",
+                    "Accept-Language: en-US,en;q=0.9,zh-CN;q=0.8,zh;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+                    "Cache-Control: no-cache",
+                    "Connection: keep-alive",
+                    "Cookie: buvid3=5566647C-DDE5-4AFF-8711-89C9DB2B7061110244infoc; LIVE_BUVID=AUTO2315591376644842; sid=kbyrjw72; stardustvideo=1; CURRENT_FNVAL=16; rpdid=|(J~|JluJmmk0J'ullmuJ~~kJ; CURRENT_QUALITY=80; UM_distinctid=16b11bb4099eb-033fd8b69a435d-37647e03-13c680-16b11bb40bf97; fts=1562149769; im_notify_type_279025=0; _uuid=69A60E94-E8FE-54B8-DCCD-0F519F0DEF7480343infoc; DedeUserID=279025; DedeUserID__ckMd5=9a79e15294e6b8bb; SESSDATA=b114a39d%2C1573361994%2C2ed0a2a1; bili_jct=b35f8e9780e4a80dd07f316f781f179b; bp_t_offset_279025=317592473398470273",
+                    "Host: api.bilibili.com",
+                    "Origin: https://space.bilibili.com",
+                    "Postman-Token: c7f849ec-aaf9-4c71-851d-4ca061e725d0,f8f582bc-4872-4aa7-b209-b926364d4d1a",
+                    "Referer: https://space.bilibili.com/279025/favlist",
+                    "Sec-Fetch-Mode: cors",
+                    "Sec-Fetch-Site: same-site",
+                    "User-Agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/78.0.3904.70 Safari/537.36",
+                    "cache-control: no-cache"
+                ),
+            ));
+
+            $response = curl_exec($curl);
+            $err = curl_error($curl);
+
+            curl_close($curl);
+
+            if ($err) {
+                echo "cURL Error #:" . $err;
+            } else {
+                $responseArr = json_decode($response, true);
+                if ($responseArr['code'] == 0) {
+                    $data = $responseArr['data'];
+                    $medias = $data['medias'];
+                    if (count($medias) > 0) {
+                        foreach ($medias as $item) {
+                            if ($item['title'] != $invalidTitle) {
+                                echo "av" . $item['id'] . " ";
+                            }
+                        }
+                    }
+                }
+            }
+            usleep(random_int(1000, 10000) * 1000);
+        }
+    }
+
+    public function queryCollectionList()
+    {
+
+
+        //        $curl = curl_init();
+        //
+        //        curl_setopt_array($curl, array(
+        //            CURLOPT_URL => "https://api.bilibili.com/medialist/gateway/base/created?pn=1&ps=100&up_mid=279025&is_space=0&jsonp=jsonp",
+        //            CURLOPT_RETURNTRANSFER => true,
+        //            CURLOPT_ENCODING => "",
+        //            CURLOPT_MAXREDIRS => 10,
+        //            CURLOPT_TIMEOUT => 0,
+        //            CURLOPT_FOLLOWLOCATION => true,
+        //            CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+        //            CURLOPT_CUSTOMREQUEST => "GET",
+        //            CURLOPT_HTTPHEADER => array(
+        //                "Connection: keep-alive",
+        //                "Pragma: no-cache",
+        //                "Cache-Control: no-cache",
+        //                "Accept: application/json, text/plain, */*",
+        //                "Origin: https://space.bilibili.com",
+        //                "User-Agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/79.0.3945.88 Safari/537.36",
+        //                "Sec-Fetch-Site: same-site",
+        //                "Sec-Fetch-Mode: cors",
+        //                "Referer: https://space.bilibili.com/279025/favlist?spm_id_from=333.851.b_696e7465726e6174696f6e616c486561646572.15",
+        //                "Accept-Encoding: gzip, deflate, br",
+        //                "Accept-Language: zh-CN,zh;q=0.9,en-US;q=0.8,en;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+        //                "Cookie: _uuid=D6E5438B-5A95-439F-7512-FC3509457A9A28409infoc; buvid3=5566647C-DDE5-4AFF-8711-89C9DB2B7061110244infoc; LIVE_BUVID=AUTO3415734420289108; UM_distinctid=16e62db8b9934b-0f76f63ae51bee-1c3c6a5a-13c680-16e62db8b9acaf; CURRENT_FNVAL=16; stardustvideo=1; rpdid=|(ku|l|lRYlJ0J'ul~JYuYY|u; finger=0539dad4; im_notify_type_279025=0; sid=llgc5h9q; DedeUserID=279025; DedeUserID__ckMd5=9a79e15294e6b8bb; bili_jct=07b8811aa5ca68020eb0c11e0e01c22f; laboratory=1-1; CURRENT_QUALITY=80; SESSDATA=64a15917%2C1578628130%2Ceb05cdc1; bp_t_offset_279025=336855788264916597; INTVER=1"
+        //            ),
+        //        ));
+        //
+        //        $response = curl_exec($curl);
+        $response = $this->requestCollectionNumberList($this->collectionNumberListUrl, 1);
+
+        $res = json_decode($response, true);
+        if ($res['code'] == 0) {
+            $list = $res['data']['list'];
+            foreach ($list as $item) {
+                $collection = new BilibiliCollections();
+                $collection->title = $item["title"];
+                $collection->is_downloaded = 0;
+                $collection->media_id = $item["id"];
+                $currentList = [];
+                for ($pageNo = 1; $pageNo < 100; $pageNo++) {
+                    $listResponse = $this->requestCollectionList($this->collectionListUrl, $item['id'], $pageNo);
+                    dump("pageNo: " . $pageNo);
+                    dump($listResponse);
+                    $responseArr = json_decode($listResponse, true);
+                    if ($responseArr['code'] == 0) {
+                        $data = $responseArr["data"];
+                        $medias = Arr::get($data, "medias", []);
+                        if (count($medias) > 0) {
+                            foreach ($medias as $media) {
+                                if ($media['title'] != $this->invalidTitle) {
+                                    $currentList[] = $media["id"];
+                                }
+                            }
+                        } else {
+                            break;
+                        }
+                    }
+                }
+                $collection->videos = json_encode($currentList);
+                $collection->save();
+            }
+        }
+
+        //        curl_close($curl);
+        echo $response;
+
+    }
+
+    public function queryDBCollectionList()
+    {
+        $list = BilibiliCollections::all();
+        foreach ($list as $item) {
+            Log::info("schedule queryDBCollectionList current collection is: " . $item['title'] . " started at :" . date("Y-m-d H:i:s"));
+            $currentList = [];
+            for ($pageNo = 1; $pageNo < 100; $pageNo++) {
+                $listResponse = $this->requestCollectionList($this->collectionListUrl, $item['media_id'], $pageNo);
+//                dump("pageNo: " . $pageNo);
+//                dump($listResponse);
+                $responseArr = json_decode($listResponse, true);
+                if ($responseArr['code'] == 0) {
+                    $data = $responseArr["data"];
+                    $medias = Arr::get($data, "medias", []);
+                    if (count($medias) > 0) {
+                        foreach ($medias as $media) {
+                            if ($media['title'] != $this->invalidTitle) {
+                                $bVideo = BilibiliVideos::firstOrCreate(["aid" => $media["id"]],
+                                    [
+                                        "title" => $media["title"],
+                                        "from_type" => 1,
+                                        "from_collection_name" => $item['title']
+                                    ]);
+                                if ($bVideo->from_type != 1) {
+                                    $bVideo->from_type = 3;
+                                    $bVideo->from_collection_name = $item["title"];
+                                }
+                                $bVideo->save();
+                                $currentList[] = $media["id"];
+                            }
+                        }
+                    } else {
+                        break;
+                    }
+                }
+            }
+            $item->videos = json_encode($currentList);
+            $item->save();
+        }
+    }
+
+    public function queryForVideoParts()
+    {
+        $i = 1;
+        $list = BilibiliVideos::simplePaginate(50, null, 'page', $i);
+//        dump($list->items()[0]->aid);
+        while ($list->isNotEmpty()) {
+            foreach ($list->items() as $item) {
+//                dump("current item", [$item->getAttributes()]);
+                $response = $this->requestVideoParts($item->aid);
+                $partList = Arr::get(json_decode($response, true), "data");
+                if (count($partList) > 0) {
+                    foreach ($partList as $part) {
+                        if ($item["from_type"] == 1) {
+                            if ($item["from_collection_name"] == "默认收藏夹") {
+                                $downloadPath = $this->baseDir . "bilibili";
+                            } else {
+                                $downloadPath = $this->baseDir . "bilibili/" . $item["from_collection_name"];
+                            }
+                        } else {
+                            $downloadPath = $this->baseDir . "bilibili/" . $item["from_up_name"];
+                        }
+                        $pItem = BilibiliVideoParts::firstOrCreate([
+                            "aid" => $item->aid,
+                            "page" => $part["page"]
+                        ], [
+                            "title" => $item["title"],
+                            "part" => $part["part"],
+                            "duration" => $part["duration"],
+                            "to_download_path" => $downloadPath
+                        ]);
+                        $pItem["title"] = $item["title"];
+                        $pItem["to_download_path"] = $downloadPath;
+                        $pItem->save();
+                    }
+                    $item->total_parts = count($partList);
+                    $item->save();
+                }
+
+            }
+            $i++;
+            $list = BilibiliVideos::simplePaginate(50, null, 'page', $i);
+            try {
+                usleep(random_int(10, 1000) * 1000);
+            } catch (\Exception $e) {
+            }
+        }
+
+//        while ($list->hasPages()) {
+//            foreach ($list as $item) {
+//                $item->
+//            }
+//            $list = BilibiliVideos::simplePaginate()
+//        }
+    }
+
+    /**
+     * 检查是否已下载
+     */
+    public function checkVideoHasDownload()
+    {
+        $i = 1;
+        $list = BilibiliVideos::simplePaginate(50, null, 'page', $i);
+        $dirFiles = [];
+        while ($list->isNotEmpty()) {
+            foreach ($list->items() as $item) {
+//                dump("current item", [$item->getAttributes()]);
+                if ($item['is_download'] == 0) {
+                    continue;
+                }
+                $list = BilibiliVideoParts::where(['aid' => $item['aid']])->get();
+                if (count($list) > 0) {
+                    foreach ($list as $part) {
+//                        dump("here is parts", [$part->getAttributes()]);
+                        if (is_dir($part["to_download_path"])) {
+//                            dump("this is path ".$part["to_download_path"]);
+                            if (array_key_exists($part["to_download_path"], $dirFiles)) {
+                                $files = Arr::get($dirFiles, $part["to_download_path"]);
+                            } else {
+                                $files = scandir($part["to_download_path"]);
+                                $dirFiles[$part["to_download_path"]] = $files;
+                            }
+//                            dump($files);
+                            $itemCount = 0;
+                            $toRemove = [];
+                            foreach ($files as $file) {
+                                if ($file == "." || $file == "..") {
+                                    continue;
+                                } else {
+//                                    dump("current file: ". $file ." ".$part["title"]);
+                                    $pos = strpos($file, $part["title"]);
+//                                    dump("current compare result " . $pos);
+                                    if ($pos !== false) {
+//                                        dump($file);
+                                        $itemCount++;
+                                        if (strpos($file, $part["title"] . " P" . $part["page"]) !== false) {
+                                            Log::info("file matched " . $file);
+                                            $toRemove[] = $file;
+                                            $part["is_downloaded"] = 1;
+                                            $part->save();
+                                        }
+                                    }
+                                }
+                            }
+                            $dirFiles[$part["to_download_path"]] = array_diff($files, $toRemove);
+                            if ($itemCount == $item["total_parts"]) {
+                                $item["is_downloaded"] = 1;
+                                $item->save();
+                            }
+                        }
+                    }
+                }
+//                exit;
+            }
+            $i++;
+            $list = BilibiliVideos::simplePaginate(50, null, 'page', $i);
+//            exit;
+        }
+    }
+
+    public function requestVideoParts($aid)
+    {
+        return $this->request($this->videoPartsUrl . $aid);
+    }
+
+    public function requestCollectionList($url, $mediaId, $pn)
+    {
+        return $this->request($url . "&media_id=" . $mediaId . "&pn=" . $pn, true);
+    }
+
+    public function requestCollectionNumberList($url, $pn)
+    {
+        return $this->request($url . "&pn=" . $pn);
+    }
+
+    public function request($url, $userCookie = false)
+    {
+        $curl = curl_init();
+
+        $headerArray = array(
+            "Connection: keep-alive",
+            "Pragma: no-cache",
+            "Cache-Control: no-cache",
+            "Accept: application/json, text/plain, */*",
+            "Origin: https://space.bilibili.com",
+            "User-Agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/79.0.3945.88 Safari/537.36",
+            "Sec-Fetch-Site: same-site",
+            "Sec-Fetch-Mode: cors",
+            "Referer: https://space.bilibili.com/279025/favlist?spm_id_from=333.851.b_696e7465726e6174696f6e616c486561646572.15",
+            "Accept-Encoding: gzip, deflate, br",
+            "Accept-Language: zh-CN,zh;q=0.9,en-US;q=0.8,en;q=0.7,zh-TW;q=0.6,ja;q=0.5",
+            //                "Cookie: SESSDATA=64a15917%2C1578628130%2Ceb05cdc1"
+        );
+        if ($userCookie) {
+            $headerArray[] = "Cookie: SESSDATA=622d365f%2C1611483669%2C8c222*71;";
+//            $headerArray[] = "Cookie: _uuid=D6E5438B-5A95-439F-7512-FC3509457A9A28409infoc; buvid3=5566647C-DDE5-4AFF-8711-89C9DB2B7061110244infoc; LIVE_BUVID=AUTO3415734420289108; UM_distinctid=16e62db8b9934b-0f76f63ae51bee-1c3c6a5a-13c680-16e62db8b9acaf; CURRENT_FNVAL=16; stardustvideo=1; rpdid=|(ku|l|lRYlJ0J'ul~JYuYY|u; im_notify_type_279025=0; sid=llgc5h9q; laboratory=1-1; CURRENT_QUALITY=80; INTVER=1; DedeUserID=279025; DedeUserID__ckMd5=9a79e15294e6b8bb; SESSDATA=b169300a%2C1581262828%2C3654f611; bili_jct=597a5b9adb6170698e396fb053bc4aba; bp_t_offset_279025=343238964368145599";
+        }
+
+        curl_setopt_array($curl, array(
+            CURLOPT_URL => $url,
+            CURLOPT_RETURNTRANSFER => true,
+            CURLOPT_ENCODING => "",
+            CURLOPT_MAXREDIRS => 10,
+            CURLOPT_TIMEOUT => 0,
+            CURLOPT_FOLLOWLOCATION => true,
+            CURLOPT_HTTP_VERSION => CURL_HTTP_VERSION_1_1,
+            CURLOPT_CUSTOMREQUEST => "GET",
+            CURLOPT_HTTPHEADER => $headerArray
+        ));
+
+        $response = curl_exec($curl);
+
+        $err = curl_error($curl);
+        curl_close($curl);
+
+        if ($err) {
+            \Log::error($err);
+            return null;
+        }
+        return $response;
+    }
+
+    public function downloadBSitePlaylist($aidList, $dir = "/Volumes/intel660p/video/mv/mp4", $subDir)
+    {
+        dump("downloadBSitePlaylist : xxxxxxxxxxxxxxxxxxxxxxxxxxxx");
+        $dirExists = is_dir($dir);
+        if ($dirExists) {
+            $innerDir = $dir . "/" . $subDir;
+            if (!is_dir($innerDir)) {
+                mkdir($innerDir);
+            }
+            foreach ($aidList as $aid) {
+                Log::info("current download command is : cd '{$innerDir}' && annie -r https://www.bilibili.com/video/av80815149  -p " . $aid);
+                $downloadResult = shell_exec('cd "' .$innerDir .'" && annie  -r https://www.bilibili.com/video/av80815149 -p ' . $aid);
+                Log::info($downloadResult);
+                Log::info("current download result: " . $downloadResult);
+                try {
+                    usleep(random_int(1000, 10000) * 1000);
+                } catch (\Exception $e) {
+                }
+            }
+        }
+    }
+
+    public function partDownloadBSitePlaylist($aidMap, $dir = "/Volumes/intel660p/video/mv/mp4", $subDir)
+    {
+        dump("partDownloadBSitePlaylist");
+        dump($aidMap);
+        dump($dir);
+        $dirExists = is_dir($dir);
+        dump($dirExists);
+        if ($dirExists) {
+            $innerDir = $dir . "/" . $subDir;
+            dump($innerDir);
+            if (!is_dir($innerDir)) {
+                mkdir($innerDir);
+            }
+            foreach ($aidMap as $aid => $parts) {
+                dump($aid);
+                Log::info("current download command is : cd '{$innerDir}' && annie -r https://www.bilibili.com/video/av80815149  -p " . $aid);
+                $downloadResult = shell_exec('cd "' .$innerDir .'" && url="https://www.bilibili.com/video/av' . $aid . '?p="
+for i in $(seq 1 ' . $parts . ')
+do
+annie -c "SESSDATA=622d365f%2C1611483669%2C8c222*71" $url$i
+done ' );
+                Log::info($downloadResult);
+                Log::info("current download result: " . $downloadResult);
+                try {
+                    usleep(random_int(1000, 10000) * 1000);
+                } catch (\Exception $e) {
+                }
+            }
+        }
+    }
+
+    public function deleteFileNotContainP()
+    {
+        $dir = "/Volumes/intel660p/video/mv/mp4";
+        $files = scandir($dir);
+        foreach ($files as $file) {
+            if ($file == "." || $file == "..") {
+                continue;
+            }
+            if (preg_match("#P\d{1,2}#", $file)) {
+                echo $file . "\n";
+            } else {
+                echo "to delete file " . $file . "\n";
+                unlink($dir . "/" . $file);
+            }
+        }
+    }
+
+    public function compareAndDownloadNewVideos()
+    {
+        $list = BilibiliCollections::all();
+        foreach ($list as $item) {
+            if ($item['is_downloaded'] == 1) {
+                continue;
+            }
+            $undownloaded = array_diff($item['videos'], $item['downloaded_videos']);
+        }
+        dump($list);
+    }
+
+    public function commonRequest($url, $cookie, $media_id, $pageNo)
+    {
+        $client = new Client([
+            // Base URI is used with relative requests
+            'base_uri' => 'https://api.bilibili.com',
+            // You can set any number of default request options.
+            'timeout' => 2.0,
+        ]);
+        $jar = new \GuzzleHttp\Cookie\CookieJar;
+        $r = $client->request('GET', 'http://httpbin.org/cookies', [
+            'cookies' => $jar
+        ]);
+    }
+
+    public function insertDBTest()
+    {
+        $aNo = 484525;
+        for ($i = 0; $i < 5000000; $i++) {
+            $tempANo = $aNo + $i;
+            $sql = "insert into `bilibili_video_temps`( `aid`, `title`, `from_type`, `from_collection_name`, `from_up_name`, `is_download`, `is_downloaded`, `total_parts`, `created_at`, `updated_at`) VALUES ( " .$tempANo . ", '【钢琴】《鬼灭之刃》OP《红莲华》by LiSA', 2, '', '绯绯', 1, 1, 1, '2020-01-08 10:05:40', '2020-01-13 23:35:17');";
+            $result = DB::insert($sql);
+            if ($i % 100 == 0) {
+                print_r($result);
+            }
+            usleep(10);
+        }
+    }
+}